The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447087, 92 ID: ALA3951038
PubChem CID: 46926061
Max Phase: Preclinical
Molecular Formula: C26H22BrN5O2
Molecular Weight: 516.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)NCc2ccccc2)C(c2ccccc2Br)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C26H22BrN5O2/c1-16-22(24(33)28-15-17-9-3-2-4-10-17)23(18-11-5-6-12-19(18)27)31-25(29-16)32-26-30-20-13-7-8-14-21(20)34-26/h2-14,23H,15H2,1H3,(H,28,33)(H2,29,30,31,32)
Standard InChI Key: QBCDATKPKXUQHJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.6572 -7.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5341 -9.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0342 -9.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7817 -10.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0293 -12.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5293 -12.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7817 -10.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5817 -10.9169 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-0.4640 -9.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6640 -9.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2838 -10.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4685 -12.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2793 -13.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4707 -14.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2793 -16.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7793 -16.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5293 -14.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7793 -13.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 8 2 0
6 17 1 0
17 2 1 0
4 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
3 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.40Molecular Weight (Monoisotopic): 515.0957AlogP: 5.29#Rotatable Bonds: 5Polar Surface Area: 91.55Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.18CX Basic pKa: 4.95CX LogP: 4.81CX LogD: 4.81Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -0.97
References 1. (2016) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 2. (2019) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,