The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,5S)-7-(4-(4-fluorophenyl)-2-isopropylquinolin-3-yl)-3,5-dihydroxyhept-6-enoic acid ID: ALA3951152
PubChem CID: 57494127
Max Phase: Preclinical
Molecular Formula: C25H26FNO4
Molecular Weight: 423.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1nc2ccccc2c(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)O
Standard InChI: InChI=1S/C25H26FNO4/c1-15(2)25-21(12-11-18(28)13-19(29)14-23(30)31)24(16-7-9-17(26)10-8-16)20-5-3-4-6-22(20)27-25/h3-12,15,18-19,28-29H,13-14H2,1-2H3,(H,30,31)/b12-11+/t18-,19-/m1/s1
Standard InChI Key: HWEHUXJJTRFUKM-MCBHFWOFSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
16.6767 -6.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0933 -6.9438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0904 -6.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3818 -5.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3836 -7.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6756 -6.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9695 -7.3529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9702 -8.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6829 -8.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3861 -8.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9710 -5.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9721 -4.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2651 -4.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5566 -4.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5594 -5.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2669 -6.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3794 -4.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0859 -4.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0834 -3.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8394 -3.2519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3745 -3.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3721 -2.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6631 -2.0407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0786 -2.0365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7966 -5.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5059 -6.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7935 -4.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8482 -4.4912 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.0761 -1.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7826 -0.8086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3672 -0.8128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
5 2 2 0
2 3 1 0
3 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
1 11 1 0
4 17 1 0
17 18 2 0
18 19 1 0
19 20 1 6
19 21 1 0
21 22 1 0
22 23 1 1
22 24 1 0
3 25 1 0
25 26 1 0
25 27 1 0
14 28 1 0
24 29 1 0
29 30 1 0
29 31 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.48Molecular Weight (Monoisotopic): 423.1846AlogP: 4.76#Rotatable Bonds: 8Polar Surface Area: 90.65Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.15CX Basic pKa: 4.92CX LogP: 3.33CX LogD: 1.35Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: 0.18
References 1. Talele TT.. (2016) The "Cyclopropyl Fragment" is a Versatile Player that Frequently Appears in Preclinical/Clinical Drug Molecules., 59 (19): [PMID:27299736 ] [10.1021/acs.jmedchem.6b00472 ]