Crinipellin F

ID: ALA3952820

PubChem CID: 134145005

Max Phase: Preclinical

Molecular Formula: C20H28O3

Molecular Weight: 316.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)[C@H]1CC[C@]23C[C@@H]4[C@H](C)C(=O)[C@H]5O[C@]54[C@@]2(C)CC(=O)[C@]13C

Standard InChI:  InChI=1S/C20H28O3/c1-10(2)12-6-7-19-8-13-11(3)15(22)16-20(13,23-16)17(19,4)9-14(21)18(12,19)5/h10-13,16H,6-9H2,1-5H3/t11-,12+,13+,16+,17-,18-,19-,20-/m0/s1

Standard InChI Key:  XTHSBZKJZOMAJE-PGDSUDNMSA-N

Molfile:  

     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
   12.1475   -4.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8928   -5.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5561   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2158   -5.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9647   -4.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8826   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6321   -6.5650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8108   -6.5650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2953   -7.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9545   -6.5650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7039   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2953   -5.0746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7358   -6.8156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2953   -7.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3774   -7.3423    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6468   -4.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3014   -6.5650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4842   -6.5650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2296   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4482   -5.5290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8120   -6.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2774   -4.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2296   -4.8193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6632   -3.8589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5047   -5.6087    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  4  1  0
  7  6  1  0
  8  7  1  0
  3  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11  6  1  0
 11 12  1  0
  6 12  1  6
 10 13  2  0
  9 14  1  1
  7 15  1  6
  4 16  1  1
  3 17  1  1
 18 17  1  0
 19 18  1  0
  2 19  1  0
 19 20  1  6
 20 21  1  0
 20 22  1  0
  2 23  1  6
  1 24  2  0
 11 25  1  1
M  END

Alternative Forms

  1. Parent:

    ALA3952820

    ---

Associated Targets(Human)

MONO-MAC-6 (495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STAT1 Tchem Signal transducer and activator of transcription 1-alpha/beta (808 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.44Molecular Weight (Monoisotopic): 316.2038AlogP: 3.40#Rotatable Bonds: 1
Polar Surface Area: 46.67Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.70Np Likeness Score: 2.47

References

1. Rohr M, Oleinikov K, Jung M, Sandjo LP, Opatz T, Erkel G..  (2017)  Anti-inflammatory tetraquinane diterpenoids from a Crinipellis species.,  25  (2): [PMID:27887964] [10.1016/j.bmc.2016.11.016]

Source