2-(4-(ethylsulfonyl)phenyl)-3-(4-(2-(piperidin-1-yl)ethoxy)phenoxy)benzo[b]thiophen-6-ol

ID: ALA395291

PubChem CID: 44427405

Max Phase: Preclinical

Molecular Formula: C29H31NO5S2

Molecular Weight: 537.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(-c2sc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1

Standard InChI:  InChI=1S/C29H31NO5S2/c1-2-37(32,33)25-13-6-21(7-14-25)29-28(26-15-8-22(31)20-27(26)36-29)35-24-11-9-23(10-12-24)34-19-18-30-16-4-3-5-17-30/h6-15,20,31H,2-5,16-19H2,1H3

Standard InChI Key:  QQOLSZOGLJIRPW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   11.9420   -1.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9406   -1.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6533   -2.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6514   -0.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3691   -1.1001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3697   -1.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1604   -2.1877    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.6486   -1.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1596   -0.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4692   -1.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8814   -2.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7053   -2.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1179   -1.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7007   -0.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8782   -0.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2259   -2.3426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4133   -0.0584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9666    0.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3454    1.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8994    2.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0749    2.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6983    1.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1465    0.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6273    2.7138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8036    2.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3561    3.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5325    3.3237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0810    4.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2609    3.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8809    3.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3274    2.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1538    2.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9426   -1.5127    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.7651   -1.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9414   -0.6881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9460   -2.3374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1781   -2.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 17 18  1  0
  8  9  2  0
 18 19  2  0
  9  5  1  0
 19 20  1  0
  4  1  1  0
 20 21  2  0
  5  6  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 11 12  1  0
 24 25  1  0
  2  3  1  0
 25 26  1  0
 12 13  2  0
 26 27  1  0
 27 28  1  0
  3  6  2  0
 13 14  1  0
  1  2  2  0
 14 15  2  0
 15 10  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
  8 10  1  0
 13 33  1  0
  5  4  2  0
 33 34  1  0
  2 16  1  0
 33 35  2  0
  6  7  1  0
 33 36  2  0
  9 17  1  0
 34 37  1  0
M  END

Associated Targets(Human)

Ishikawa (877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR2 Tclin Estrogen receptor beta (9272 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR1 Tclin Estrogen receptor alpha (17718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.70Molecular Weight (Monoisotopic): 537.1644AlogP: 6.72#Rotatable Bonds: 9
Polar Surface Area: 76.07Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.47CX Basic pKa: 8.68CX LogP: 5.40CX LogD: 4.36
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.02

References

1. Richardson TI, Frank SA, Wang M, Clarke CA, Jones SA, Ying BP, Kohlman DT, Wallace OB, Shepherd TA, Dally RD, Palkowitz AD, Geiser AG, Bryant HU, Henck JW, Cohen IR, Rudmann DG, McCann DJ, Coutant DE, Oldham SW, Hummel CW, Fong KC, Hinklin R, Lewis G, Tian H, Dodge JA..  (2007)  Structure-activity relationships of SERMs optimized for uterine antagonism and ovarian safety.,  17  (13): [PMID:17482463] [10.1016/j.bmcl.2007.04.044]

Source