(1S,2R,3S,4R,5R,6R)-2-amino-3-(3-chlorobenzyloxy)-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid

ID: ALA3953570

PubChem CID: 134144441

Max Phase: Preclinical

Molecular Formula: C15H16ClNO6

Molecular Weight: 341.75

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N[C@]1(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@@H]2[C@@H](O)[C@H]1OCc1cccc(Cl)c1

Standard InChI:  InChI=1S/C15H16ClNO6/c16-7-3-1-2-6(4-7)5-23-12-11(18)8-9(13(19)20)10(8)15(12,17)14(21)22/h1-4,8-12,18H,5,17H2,(H,19,20)(H,21,22)/t8-,9-,10-,11+,12+,15+/m0/s1

Standard InChI Key:  CNBSEOHDTNDGOV-AFJGUQMISA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   11.0321   -4.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4543   -3.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2428   -4.6400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9429   -3.1967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4671   -2.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6804   -3.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6903   -2.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9763   -3.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1592   -3.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7592   -2.4530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7420   -3.8683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7262   -1.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7601   -3.2048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1757   -2.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9928   -2.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8214   -4.2170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8206   -5.2179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6825   -1.9563    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6742   -4.4079    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3923   -3.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2086   -3.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6251   -2.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2191   -1.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4041   -1.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6099   -3.9439    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3  2  1  0
  6  2  1  0
  2  4  1  0
  4  5  1  0
  5  7  1  0
  7  6  1  0
  8  7  1  0
  6  8  1  0
  8  9  1  1
  9 10  2  0
  9 11  1  0
  5 12  1  1
  4 13  1  1
 13 14  1  0
 14 15  1  0
  1 16  1  0
  1 17  2  0
  7 18  1  1
  6 19  1  1
 15 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 15  1  0
 21 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3953570

    ---

Associated Targets(Human)

GRM3 Tchem Metabotropic glutamate receptor 3 (732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GRM2 Tchem Metabotropic glutamate receptor 2 (3206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 341.75Molecular Weight (Monoisotopic): 341.0666AlogP: 0.33#Rotatable Bonds: 5
Polar Surface Area: 130.08Molecular Species: ZWITTERIONHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 1.71CX Basic pKa: 8.87CX LogP: -2.04CX LogD: -5.22
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.61Np Likeness Score: 0.53

References

1. Dressman BA, Tromiczak EG, Chappell MD, Tripp AE, Quimby SJ, Vetman T, Fivush AM, Matt J, Jaramillo C, Li R, Khilevich A, Blanco MJ, Smith SC, Carpintero M, de Diego JE, Barberis M, García-Cerrada S, Soriano JF, Schkeryantz JM, Witkin JM, Wafford KA, Seidel W, Britton T, Overshiner CD, Li X, Wang XS, Heinz BA, Catlow JT, Swanson S, Bedwell D, Ornstein PL, Mitch CH..  (2016)  Novel bicyclo[3.1.0]hexane analogs as antagonists of metabotropic glutamate 2/3 receptors for the treatment of depression.,  26  (23): [PMID:27836401] [10.1016/j.bmcl.2016.10.067]

Source