S-[(1S)-2-[(1-Iminoethyl)amino]-1-methylethyl]-2-methyl-L-cysteine dihydrochloride

ID: ALA3953808

PubChem CID: 134144338

Max Phase: Preclinical

Molecular Formula: C8H20Cl2N4O2S

Molecular Weight: 234.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](CNC(=N)N)SC[C@](C)(N)C(=O)O.Cl.Cl

Standard InChI:  InChI=1S/C8H18N4O2S.2ClH/c1-5(3-12-7(9)10)15-4-8(2,11)6(13)14;;/h5H,3-4,11H2,1-2H3,(H,13,14)(H4,9,10,12);2*1H/t5-,8-;;/m0../s1

Standard InChI Key:  MTMKULHADXAYBJ-TZPPCYDQSA-N

Molfile:  

     RDKit          2D

 17 14  0  0  0  0  0  0  0  0999 V2000
    7.9848  -19.5054    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.8285  -16.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2452  -17.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6574  -16.6542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1037  -17.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8181  -17.3775    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.5325  -17.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9613  -17.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6757  -17.3775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9613  -18.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3892  -17.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6748  -17.7899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9604  -17.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2460  -17.7899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9604  -16.5525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1037  -18.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9152  -19.3875    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  3  4  1  6
  5  6  1  0
  6  7  1  0
  7  3  1  0
  3  8  1  0
  8  9  1  0
  8 10  2  0
  5 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
  5 16  1  1
M  END

Associated Targets(Human)

NOS1 Tchem Nitric-oxide synthase, brain (1786 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOS3 Tchem Nitric-oxide synthase, endothelial (1452 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOS2 Tchem Nitric oxide synthase, inducible (1636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 234.32Molecular Weight (Monoisotopic): 234.1150AlogP: -0.61#Rotatable Bonds: 6
Polar Surface Area: 125.22Molecular Species: ZWITTERIONHBA: 4HBD: 5
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 7#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.42CX Basic pKa: 12.18CX LogP: -2.39CX LogD: -4.24
Aromatic Rings: Heavy Atoms: 15QED Weighted: 0.31Np Likeness Score: 0.20

References

1.  (2002)  Amidino compounds useful as nitric oxide synthase inhibitors, 

Source