The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9156810, (74, 75) ID: ALA3954031
PubChem CID: 10434119
Max Phase: Preclinical
Molecular Formula: C26H30O5S
Molecular Weight: 454.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)C(=O)[C@H](CC#CCCCC(=O)O)[C@@H](/C=C/C(O)Cc2cc3ccccc3s2)[C@@H]1O
Standard InChI: InChI=1S/C26H30O5S/c1-26(2)24(30)20(10-5-3-4-6-12-23(28)29)21(25(26)31)14-13-18(27)16-19-15-17-9-7-8-11-22(17)32-19/h7-9,11,13-15,18,20-21,25,27,31H,4,6,10,12,16H2,1-2H3,(H,28,29)/b14-13+/t18?,20-,21-,25+/m1/s1
Standard InChI Key: MNSSULPKPIROKW-ZNVAMYPYSA-N
Molfile:
RDKit 2D
32 34 0 0 1 0 0 0 0 0999 V2000
5.2934 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3332 -11.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4409 -12.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0214 -9.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8190 -8.8637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5405 -9.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7928 -8.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5451 -7.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5974 -5.7189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9195 -10.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4510 -11.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5429 -10.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5369 -9.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5308 -7.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0019 -8.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9958 -7.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4668 -7.3680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2616 -6.4689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.8485 -8.5057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0342 -11.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9087 -13.1708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 6
4 6 1 0
6 7 1 1
7 8 2 0
8 9 1 0
9 10 1 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
19 20 1 0
20 12 1 0
6 21 1 0
21 22 1 6
22 23 1 0
23 24 3 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
21 31 1 0
31 2 1 0
31 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.59Molecular Weight (Monoisotopic): 454.1814AlogP: 4.21#Rotatable Bonds: 8Polar Surface Area: 94.83Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.07CX Basic pKa: ┄CX LogP: 5.08CX LogD: 1.96Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: 0.76
References 1. (2015) Treatment of inflammatory bowel disease,