US9156810, (74, 75)

ID: ALA3954031

PubChem CID: 10434119

Max Phase: Preclinical

Molecular Formula: C26H30O5S

Molecular Weight: 454.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)C(=O)[C@H](CC#CCCCC(=O)O)[C@@H](/C=C/C(O)Cc2cc3ccccc3s2)[C@@H]1O

Standard InChI:  InChI=1S/C26H30O5S/c1-26(2)24(30)20(10-5-3-4-6-12-23(28)29)21(25(26)31)14-13-18(27)16-19-15-17-9-7-8-11-22(17)32-19/h7-9,11,13-15,18,20-21,25,27,31H,4,6,10,12,16H2,1-2H3,(H,28,29)/b14-13+/t18?,20-,21-,25+/m1/s1

Standard InChI Key:  MNSSULPKPIROKW-ZNVAMYPYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  1  0  0  0  0  0999 V2000
    5.2934  -10.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3332  -11.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4409  -12.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0214   -9.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8190   -8.8637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5405   -9.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7928   -8.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5451   -7.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7974   -5.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5974   -5.7189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497   -4.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.9195  -10.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4510  -11.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5429  -10.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5369   -9.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5308   -7.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0019   -8.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9958   -7.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4668   -7.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2616   -6.4689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8485   -8.5057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0342  -11.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9087  -13.1708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  6
  4  6  1  0
  6  7  1  1
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
 20 12  1  0
  6 21  1  0
 21 22  1  6
 22 23  1  0
 23 24  3  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 21 31  1  0
 31  2  1  0
 31 32  2  0
M  END

Associated Targets(Human)

PTGER1 Tclin Prostanoid EP1 receptor (1696 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTGER4 Tclin Prostanoid EP4 receptor (2181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.59Molecular Weight (Monoisotopic): 454.1814AlogP: 4.21#Rotatable Bonds: 8
Polar Surface Area: 94.83Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.07CX Basic pKa: CX LogP: 5.08CX LogD: 1.96
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: 0.76

References

1.  (2015)  Treatment of inflammatory bowel disease, 

Source

Source(1):