The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2-(4-(1H-imidazol-1-yl)phenoxy)ethyl)(benzo[d][1,3]dioxol-5-ylmethyl)amino)-N-(4-(trifluoromethyl)benzyl)acetamide ID: ALA395498
PubChem CID: 11757333
Max Phase: Preclinical
Molecular Formula: C29H27F3N4O4
Molecular Weight: 552.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN(CCOc1ccc(-n2ccnc2)cc1)Cc1ccc2c(c1)OCO2)NCc1ccc(C(F)(F)F)cc1
Standard InChI: InChI=1S/C29H27F3N4O4/c30-29(31,32)23-4-1-21(2-5-23)16-34-28(37)18-35(17-22-3-10-26-27(15-22)40-20-39-26)13-14-38-25-8-6-24(7-9-25)36-12-11-33-19-36/h1-12,15,19H,13-14,16-18,20H2,(H,34,37)
Standard InChI Key: SFGIHMAJHAGGRH-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
12.3807 -14.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0987 -14.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0958 -15.6414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3831 -16.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6690 -15.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9522 -16.0498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2382 -15.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2355 -14.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5276 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8070 -14.8115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8045 -15.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5227 -16.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0945 -14.4013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9751 -13.5823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1633 -13.4456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7822 -14.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3489 -14.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8099 -16.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8112 -16.8797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0960 -17.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0927 -18.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5211 -17.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5191 -18.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8104 -18.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9853 -19.3385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8017 -19.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1347 -18.6772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3845 -13.5683 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6656 -14.8002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0995 -13.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8108 -13.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8053 -14.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5157 -14.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5218 -13.1669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2329 -13.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2353 -14.4039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9480 -14.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6566 -15.2259 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5358 -15.5293 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.3647 -14.1062 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
19 20 2 0
7 12 1 0
20 21 1 0
21 24 2 0
8 9 1 0
23 22 2 0
22 19 1 0
23 24 1 0
9 10 2 0
10 11 1 0
11 12 2 0
1 2 1 0
10 13 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
13 14 1 0
1 28 1 0
6 7 1 0
1 29 2 0
7 8 2 0
28 30 1 0
3 4 1 0
30 31 1 0
31 32 2 0
14 15 2 0
32 33 1 0
33 36 2 0
15 16 1 0
35 34 2 0
34 31 1 0
35 36 1 0
16 17 2 0
17 13 1 0
4 5 1 0
36 37 1 0
3 18 1 0
37 38 1 0
2 3 1 0
37 39 1 0
18 19 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.55Molecular Weight (Monoisotopic): 552.1984AlogP: 4.82#Rotatable Bonds: 11Polar Surface Area: 77.85Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.83CX LogP: 4.44CX LogD: 4.34Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.29Np Likeness Score: -1.78
References 1. Wei RG, Adler M, Davey D, Ho E, Mohan R, Polokoff M, Tseng JL, Whitlow M, Xu W, Yuan S, Phillips G.. (2007) 1-(1,3-Benzodioxol-5-ylmethyl)-3-[4-(1H-imidazol-1-yl)phenoxy]-piperidine analogs as potent and selective inhibitors of nitric oxide formation., 17 (9): [PMID:17368901 ] [10.1016/j.bmcl.2007.02.053 ]