US9428478, TG6-251-2

ID: ALA3955086

PubChem CID: 71473924

Max Phase: Preclinical

Molecular Formula: C24H27N3O3

Molecular Weight: 405.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)c1ccc2[nH]c(C(=O)N3CCN(c4ccc(OC(C)C)cc4)CC3)cc2c1

Standard InChI:  InChI=1S/C24H27N3O3/c1-16(2)30-21-7-5-20(6-8-21)26-10-12-27(13-11-26)24(29)23-15-19-14-18(17(3)28)4-9-22(19)25-23/h4-9,14-16,25H,10-13H2,1-3H3

Standard InChI Key:  WDHUZZLYANGBDJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -4.8476  -14.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2402  -13.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8332  -12.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7395  -13.4959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9798  -12.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4798  -12.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2768  -10.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4666   -9.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9666   -9.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7232  -10.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2883   -8.3139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7883   -8.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5428   -7.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7974   -5.7210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2973   -5.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4572   -7.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497   -4.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7497   -4.4245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0432    3.5993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351    3.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 11  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 27 19  1  0
 23 28  1  0
 28 29  2  0
 28 30  1  0
M  END

Associated Targets(Human)

CYBB Tchem Cytochrome b-245 heavy chain (193 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.50Molecular Weight (Monoisotopic): 405.2052AlogP: 4.12#Rotatable Bonds: 5
Polar Surface Area: 65.64Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.60CX Basic pKa: 3.96CX LogP: 3.20CX LogD: 3.20
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.37

References

1.  (2016)  Piperazine derivatives, compositions, and uses related thereto, 

Source

Source(1):