The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S)1-[4-(2-methyl-5-fluoro-benzyloxy)-benzenesulfonyl]-3-methyl-5-oxo-piperazine-2-carboxylicacid hydroxyamide ID: ALA3955144
PubChem CID: 58619811
Max Phase: Preclinical
Molecular Formula: C20H22FN3O6S
Molecular Weight: 451.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(F)cc1COc1ccc(S(=O)(=O)N2CC(=O)N[C@@H](C)[C@@H]2C(=O)NO)cc1
Standard InChI: InChI=1S/C20H22FN3O6S/c1-12-3-4-15(21)9-14(12)11-30-16-5-7-17(8-6-16)31(28,29)24-10-18(25)22-13(2)19(24)20(26)23-27/h3-9,13,19,27H,10-11H2,1-2H3,(H,22,25)(H,23,26)/t13-,19+/m0/s1
Standard InChI Key: NDFMSYGPUBBXOI-ORAYPTAESA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
7.0163 -5.1219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7262 -5.5305 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7251 -4.7114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3435 -6.2512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5268 -6.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1427 -7.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5754 -7.6939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3921 -7.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7761 -6.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0941 -5.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4782 -4.8647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2774 -5.6141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8447 -4.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5445 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9531 -4.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7703 -4.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1789 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7703 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9531 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9961 -5.5314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4047 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2219 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6305 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4477 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8563 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4477 -6.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6305 -6.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2219 -4.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8247 -8.3591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8563 -7.6545 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3260 -7.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
4 9 1 0
10 11 2 0
12 13 1 0
10 12 1 0
5 10 1 6
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
2 14 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
20 21 1 0
17 20 1 0
4 2 1 0
23 28 1 0
8 29 2 0
26 30 1 0
6 31 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.48Molecular Weight (Monoisotopic): 451.1213AlogP: 1.10#Rotatable Bonds: 6Polar Surface Area: 125.04Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.70CX Basic pKa: ┄CX LogP: 1.27CX LogD: 1.25Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -1.14
References 1. (2001) Selective inhibitors of aggrecanase in osteoarthritis treatment,