The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447087, 101 ID: ALA3955981
PubChem CID: 46926077
Max Phase: Preclinical
Molecular Formula: C20H20ClN7O2
Molecular Weight: 425.88
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)NC2CC2)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C20H20ClN7O2/c1-10-15(18(29)23-11-7-8-11)17(16-12(21)9-28(2)27-16)25-19(22-10)26-20-24-13-5-3-4-6-14(13)30-20/h3-6,9,11,17H,7-8H2,1-2H3,(H,23,29)(H2,22,24,25,26)
Standard InChI Key: RBIBCAIEECKOAE-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
-1.6572 -7.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5341 -9.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0147 -9.7621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3238 -11.2299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4192 -11.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0234 -11.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9106 -10.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7349 -11.2120 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.4640 -9.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6640 -9.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2838 -10.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4685 -12.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4278 -13.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7242 -12.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 8 2 0
6 17 1 0
17 2 1 0
4 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
20 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
3 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.88Molecular Weight (Monoisotopic): 425.1367AlogP: 2.88#Rotatable Bonds: 4Polar Surface Area: 109.37Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.98CX Basic pKa: 4.77CX LogP: 2.05CX LogD: 2.05Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.30
References 1. (2016) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 2. (2019) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,