US9428478, TG6-205-2

ID: ALA3956175

PubChem CID: 123685165

Max Phase: Preclinical

Molecular Formula: C20H18F3N3O3

Molecular Weight: 405.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1cc2cc(O)ccc2[nH]1)N1CCN(c2ccc(OC(F)(F)F)cc2)CC1

Standard InChI:  InChI=1S/C20H18F3N3O3/c21-20(22,23)29-16-4-1-14(2-5-16)25-7-9-26(10-8-25)19(28)18-12-13-11-15(27)3-6-17(13)24-18/h1-6,11-12,24,27H,7-10H2

Standard InChI Key:  DZTLMHZPDFJUAT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1047   -0.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7065    1.0350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8532   -1.3040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3533   -1.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0987   -2.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3442   -3.9074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8442   -3.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0987   -2.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0900   -5.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5901   -5.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3335   -6.5202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5769   -7.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3180   -9.1205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5592  -10.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1518  -11.4588    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3592  -10.4072    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9520  -11.4504    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0769   -7.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3335   -6.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
 10  2  1  0
  7 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 13  1  0
 16 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 22 28  1  0
 28 29  2  0
 29 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3956175

    ---

Associated Targets(Human)

CYBB Tchem Cytochrome b-245 heavy chain (193 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XDH Tclin Xanthine dehydrogenase (1038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.38Molecular Weight (Monoisotopic): 405.1300AlogP: 3.73#Rotatable Bonds: 3
Polar Surface Area: 68.80Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.56CX Basic pKa: 3.51CX LogP: 4.16CX LogD: 4.15
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -1.18

References

1.  (2016)  Piperazine derivatives, compositions, and uses related thereto, 

Source

Source(1):