The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8487093, 16 ID: ALA3956247
PubChem CID: 71699860
Max Phase: Preclinical
Molecular Formula: C16H20N4O6S
Molecular Weight: 396.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc2c(c1)CCNC2)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O
Standard InChI: InChI=1S/C16H20N4O6S/c21-15(18-12-2-1-11-8-17-6-5-10(11)7-12)14-4-3-13-9-19(14)16(22)20(13)26-27(23,24)25/h1-2,7,13-14,17H,3-6,8-9H2,(H,18,21)(H,23,24,25)/t13?,14-/m0/s1
Standard InChI Key: XXIFWUYINSCSPL-KZUDCZAMSA-N
Molfile:
RDKit 2D
27 30 0 0 1 0 0 0 0 0999 V2000
8.4999 -7.2184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4256 -6.4548 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5496 -6.8751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6238 -7.6383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1770 -4.9747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7837 -4.4555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4177 -3.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7387 -4.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1238 -5.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4038 -3.2090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1495 -2.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4659 -4.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9212 -5.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
11 13 1 0
13 6 1 0
13 14 2 0
10 15 1 1
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 21 1 0
26 27 2 0
27 18 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.43Molecular Weight (Monoisotopic): 396.1104AlogP: 0.27#Rotatable Bonds: 4Polar Surface Area: 128.28Molecular Species: ZWITTERIONHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: -2.06CX Basic pKa: 8.96CX LogP: -1.14CX LogD: -1.15Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.62Np Likeness Score: -0.67
References 1. (2013) Œ=-lactamase inhibitors,