The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9409887, I-2 ID: ALA3956925
PubChem CID: 70144271
Max Phase: Preclinical
Molecular Formula: C26H26F3N7O3
Molecular Weight: 541.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(NC4CN(C(C)=O)C4)cc3OC)ncc2C(F)(F)F)c1
Standard InChI: InChI=1S/C26H26F3N7O3/c1-4-23(38)32-16-6-5-7-17(10-16)33-24-20(26(27,28)29)12-30-25(35-24)34-21-9-8-18(11-22(21)39-3)31-19-13-36(14-19)15(2)37/h4-12,19,31H,1,13-14H2,2-3H3,(H,32,38)(H2,30,33,34,35)
Standard InChI Key: GNIFAULXFNJRKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6524 5.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0999 4.7779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7066 3.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3986 5.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4348 4.9128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4049 6.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 -5.2494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9020 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1977 -2.9829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1903 -1.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4841 -0.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4738 0.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1696 1.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8758 0.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5693 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2759 0.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2862 -0.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0306 1.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0648 0.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8861 -0.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2096 -5.9864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2145 -7.1863 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.2465 -5.3824 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.2512 -6.5823 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 7 1 0
9 11 1 0
11 12 2 0
11 13 1 0
5 14 2 0
14 15 1 0
15 16 2 0
16 3 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
30 32 1 0
32 33 2 0
28 34 2 0
34 24 1 0
22 35 2 0
35 18 1 0
21 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.53Molecular Weight (Monoisotopic): 541.2049AlogP: 4.76#Rotatable Bonds: 9Polar Surface Area: 120.51Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.64CX Basic pKa: 4.78CX LogP: 3.52CX LogD: 3.52Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.31
References 1. (2016) Mutant-selective EGFR inhibitors and uses thereof,