US9206167, 9

ID: ALA3957163

PubChem CID: 24968723

Max Phase: Preclinical

Molecular Formula: C26H29N3OS

Molecular Weight: 431.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1ccc2ccccc2n1CCCCCN1CCN(c2cccc3sccc23)CC1

Standard InChI:  InChI=1S/C26H29N3OS/c30-26-12-11-21-7-2-3-8-23(21)29(26)15-5-1-4-14-27-16-18-28(19-17-27)24-9-6-10-25-22(24)13-20-31-25/h2-3,6-13,20H,1,4-5,14-19H2

Standard InChI Key:  QRSVODFJOPEHOT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6078   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6109   -7.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9117   -8.2481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9170   -9.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2187  -10.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5151   -9.7392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5099   -8.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2083   -7.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8174  -10.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1127   -9.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4155  -10.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4231  -11.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1278  -12.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8238  -14.1966    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3328  -14.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7158  -12.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8250  -11.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11  2  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 17  1  0
 20 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 23  1  0
 31 27  2  0
M  END

Associated Targets(non-human)

Htr2a Serotonin 2a (5-HT2a) receptor (3540 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.61Molecular Weight (Monoisotopic): 431.2031AlogP: 5.21#Rotatable Bonds: 7
Polar Surface Area: 28.48Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.55CX LogP: 5.12CX LogD: 3.93
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -1.53

References

1.  (2015)  Piperazine-substituted benzothiophenes for treatment of mental disorders, 

Source

Source(1):