The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9206167, 9 ID: ALA3957163
PubChem CID: 24968723
Max Phase: Preclinical
Molecular Formula: C26H29N3OS
Molecular Weight: 431.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1ccc2ccccc2n1CCCCCN1CCN(c2cccc3sccc23)CC1
Standard InChI: InChI=1S/C26H29N3OS/c30-26-12-11-21-7-2-3-8-23(21)29(26)15-5-1-4-14-27-16-18-28(19-17-27)24-9-6-10-25-22(24)13-20-31-25/h2-3,6-13,20H,1,4-5,14-19H2
Standard InChI Key: QRSVODFJOPEHOT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6078 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 -7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9117 -8.2481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9170 -9.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2187 -10.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5151 -9.7392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5099 -8.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2083 -7.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8174 -10.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1127 -9.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4155 -10.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4231 -11.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1278 -12.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8238 -14.1966 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.3328 -14.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7158 -12.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8250 -11.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 2 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 17 1 0
20 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 23 1 0
31 27 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.61Molecular Weight (Monoisotopic): 431.2031AlogP: 5.21#Rotatable Bonds: 7Polar Surface Area: 28.48Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.55CX LogP: 5.12CX LogD: 3.93Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -1.53
References 1. (2015) Piperazine-substituted benzothiophenes for treatment of mental disorders,