4''-(acetylethylamino)-3''-tert-butyl-4'-(4-hydroxybutoxy)-[1,1';3',1'']terphenyl-4-carboxylic acid

ID: ALA3957342

PubChem CID: 11634780

Max Phase: Preclinical

Molecular Formula: C31H37NO5

Molecular Weight: 503.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(C(C)=O)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCCCO)cc1C(C)(C)C

Standard InChI:  InChI=1S/C31H37NO5/c1-6-32(21(2)34)28-15-13-25(20-27(28)31(3,4)5)26-19-24(14-16-29(26)37-18-8-7-17-33)22-9-11-23(12-10-22)30(35)36/h9-16,19-20,33H,6-8,17-18H2,1-5H3,(H,35,36)

Standard InChI Key:  LRWOHFGXGXXCBZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   16.6684   -3.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3805   -4.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0926   -3.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0926   -2.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3805   -2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6684   -2.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8046   -2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8046   -1.7515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5167   -2.9813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9563   -4.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2484   -3.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5363   -4.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5363   -5.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2484   -5.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9563   -5.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8242   -5.4449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8242   -6.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5363   -6.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5363   -7.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2484   -7.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2484   -8.7270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8242   -3.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8242   -2.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1387   -2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4266   -2.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4266   -3.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1387   -4.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7145   -2.5700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0368   -2.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3248   -2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7145   -1.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0368   -1.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7198   -4.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0112   -3.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7215   -5.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0073   -4.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4267   -1.3507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 12 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 26 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 31 37  2  0
M  END

Associated Targets(Human)

RARB Tclin Retinoic acid receptor beta (1232 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RARA Tclin Retinoic acid receptor alpha (1324 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RARG Tclin Retinoic acid receptor gamma (1154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.64Molecular Weight (Monoisotopic): 503.2672AlogP: 6.54#Rotatable Bonds: 10
Polar Surface Area: 87.07Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.08CX Basic pKa: CX LogP: 5.66CX LogD: 2.55
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -0.37

References

1.  (2008)  Novel ligands that modulate RAR receptors and pharmaceutical/cosmetic compositions comprised thereof, 

Source