The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4''-(acetylethylamino)-3''-tert-butyl-4'-(4-hydroxybutoxy)-[1,1';3',1'']terphenyl-4-carboxylic acid ID: ALA3957342
PubChem CID: 11634780
Max Phase: Preclinical
Molecular Formula: C31H37NO5
Molecular Weight: 503.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(C(C)=O)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCCCO)cc1C(C)(C)C
Standard InChI: InChI=1S/C31H37NO5/c1-6-32(21(2)34)28-15-13-25(20-27(28)31(3,4)5)26-19-24(14-16-29(26)37-18-8-7-17-33)22-9-11-23(12-10-22)30(35)36/h9-16,19-20,33H,6-8,17-18H2,1-5H3,(H,35,36)
Standard InChI Key: LRWOHFGXGXXCBZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
16.6684 -3.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3805 -4.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0926 -3.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0926 -2.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3805 -2.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6684 -2.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8046 -2.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8046 -1.7515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5167 -2.9813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9563 -4.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2484 -3.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5363 -4.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5363 -5.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2484 -5.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9563 -5.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8242 -5.4449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8242 -6.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5363 -6.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5363 -7.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2484 -7.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2484 -8.7270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8242 -3.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8242 -2.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1387 -2.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4266 -2.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4266 -3.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1387 -4.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7145 -2.5700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0368 -2.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3248 -2.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7145 -1.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0368 -1.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7198 -4.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0112 -3.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7215 -5.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0073 -4.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4267 -1.3507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
4 7 1 0
7 8 2 0
7 9 1 0
1 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
13 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
12 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
25 28 1 0
28 29 1 0
29 30 1 0
28 31 1 0
31 32 1 0
26 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
31 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.64Molecular Weight (Monoisotopic): 503.2672AlogP: 6.54#Rotatable Bonds: 10Polar Surface Area: 87.07Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.08CX Basic pKa: ┄CX LogP: 5.66CX LogD: 2.55Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -0.37
References 1. (2008) Novel ligands that modulate RAR receptors and pharmaceutical/cosmetic compositions comprised thereof,