The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Phenyl 3-(5-amino-2-chloro-4-fluoro-3-methylbenzamido)-4-(4-methylpiperazin-1-yl)benzoate ID: ALA3957478
PubChem CID: 132580839
Max Phase: Preclinical
Molecular Formula: C26H26ClFN4O3
Molecular Weight: 496.97
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(F)c(N)cc(C(=O)Nc2cc(C(=O)Oc3ccccc3)ccc2N2CCN(C)CC2)c1Cl
Standard InChI: InChI=1S/C26H26ClFN4O3/c1-16-23(27)19(15-20(29)24(16)28)25(33)30-21-14-17(26(34)35-18-6-4-3-5-7-18)8-9-22(21)32-12-10-31(2)11-13-32/h3-9,14-15H,10-13,29H2,1-2H3,(H,30,33)
Standard InChI Key: VKUIARDCYFJGLG-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
12.7393 -5.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7382 -6.2427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4462 -6.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1559 -6.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1531 -5.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4444 -5.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4460 -7.4688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8642 -6.6497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5713 -6.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2797 -6.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5700 -5.4228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2763 -7.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9838 -7.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6919 -7.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6880 -6.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9799 -6.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4420 -4.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1485 -3.7864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7331 -3.7906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7392 -7.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7371 -8.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4429 -9.1012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1525 -8.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1563 -7.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4396 -9.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1461 -2.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8544 -2.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8523 -1.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1428 -1.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4340 -1.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4396 -2.5694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9744 -5.4185 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.3936 -6.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4008 -7.8673 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9847 -8.6877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
6 17 1 0
17 18 1 0
17 19 2 0
7 20 1 0
7 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
18 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
16 32 1 0
15 33 1 0
14 34 1 0
13 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.97Molecular Weight (Monoisotopic): 496.1677AlogP: 4.59#Rotatable Bonds: 5Polar Surface Area: 87.90Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.44CX LogP: 5.11CX LogD: 4.79Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.30
References 1. Li DD, Wang ZH, Chen WL, Xie YY, You QD, Guo XK.. (2016) Structure-based design of ester compounds to inhibit MLL complex catalytic activity by targeting mixed lineage leukemia 1 (MLL1)-WDR5 interaction., 24 (22): [PMID:27720555 ] [10.1016/j.bmc.2016.09.073 ]