The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8487093, 192 ID: ALA3957507
PubChem CID: 44182903
Max Phase: Preclinical
Molecular Formula: C17H23N5O6S
Molecular Weight: 425.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(C2CCNCC2)ccn1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O
Standard InChI: InChI=1S/C17H23N5O6S/c23-16(20-15-9-12(5-8-19-15)11-3-6-18-7-4-11)14-2-1-13-10-21(14)17(24)22(13)28-29(25,26)27/h5,8-9,11,13-14,18H,1-4,6-7,10H2,(H,19,20,23)(H,25,26,27)/t13-,14+/m1/s1
Standard InChI Key: IVIBSXDLKKQASQ-KGLIPLIRSA-N
Molfile:
RDKit 2D
29 32 0 0 1 0 0 0 0 0999 V2000
-1.5290 -4.1726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6608 -3.7738 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 -4.5549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4400 -4.9533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9361 -2.2985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2223 -1.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6055 1.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7867 1.6253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0965 3.2488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0640 4.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5574 5.8080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5267 6.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0027 6.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5094 5.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5401 4.1291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0197 8.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5440 8.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0395 10.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0107 11.1906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4863 10.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9907 9.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 1
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
11 13 1 0
13 6 1 0
13 14 2 0
10 15 1 6
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 24 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.47Molecular Weight (Monoisotopic): 425.1369AlogP: 0.49#Rotatable Bonds: 5Polar Surface Area: 141.17Molecular Species: ZWITTERIONHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: -2.17CX Basic pKa: 10.02CX LogP: -1.26CX LogD: -1.26Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -0.59
References 1. (2013) Œ=-lactamase inhibitors,