The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9162991, 4j ID: ALA3957901
PubChem CID: 25053573
Max Phase: Preclinical
Molecular Formula: C20H12F6N4O3
Molecular Weight: 470.33
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc([N+](=O)[O-])cc1)c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)nn1
Standard InChI: InChI=1S/C20H12F6N4O3/c21-19(22,23)14-7-13(8-15(9-14)20(24,25)26)10-29-11-17(27-28-29)18(31)6-3-12-1-4-16(5-2-12)30(32)33/h1-9,11H,10H2/b6-3+
Standard InChI Key: WBOLHGCBRRPKFO-ZZXKWVIFSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
3.6384 -0.9011 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 -2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6377 -2.1009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4470 5.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9153 5.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6607 4.2349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6532 3.1236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5322 6.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8320 7.8763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0256 7.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6437 8.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1370 8.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7567 9.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2496 10.0810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1228 8.8613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.5032 7.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0103 7.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6168 9.0047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.3139 8.0280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.1144 10.0967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6384 -0.9011 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5984 -2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6377 -2.1009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
24 26 2 0
7 27 2 0
27 28 1 0
28 29 2 0
29 5 1 0
28 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M CHG 2 24 1 25 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.33Molecular Weight (Monoisotopic): 470.0814AlogP: 5.17#Rotatable Bonds: 6Polar Surface Area: 90.92Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.74CX LogD: 5.74Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.16Np Likeness Score: -1.43
References 1. (2015) Cinnamoyl inhibitors of transglutaminase,