The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9206167, 8 ID: ALA3958663
PubChem CID: 24968722
Max Phase: Preclinical
Molecular Formula: C25H27N3OS
Molecular Weight: 417.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1ccc2ccccc2n1CCCCN1CCN(c2cccc3sccc23)CC1
Standard InChI: InChI=1S/C25H27N3OS/c29-25-11-10-20-6-1-2-7-22(20)28(25)14-4-3-13-26-15-17-27(18-16-26)23-8-5-9-24-21(23)12-19-30-24/h1-2,5-12,19H,3-4,13-18H2
Standard InChI Key: MRZPFQGTZKYGJM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6078 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 -7.4996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9100 -8.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9100 -9.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6110 -10.4997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3119 -9.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3119 -8.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6110 -12.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3108 -12.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3085 -14.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6063 -15.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9065 -14.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3316 -14.7183 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2151 -13.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3353 -12.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9089 -12.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 2 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 16 1 0
19 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 22 1 0
30 26 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.58Molecular Weight (Monoisotopic): 417.1875AlogP: 4.82#Rotatable Bonds: 6Polar Surface Area: 28.48Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.49CX LogP: 4.67CX LogD: 3.55Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.62
References 1. (2015) Piperazine-substituted benzothiophenes for treatment of mental disorders,