The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Propane-1-sulfonic acid (2,4-difluoro-3-{5-[6-(2-pyrrolidin-1-yl-ethoxy)-pyridin-3-yl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl}-phenyl)-amide ID: ALA3958968
PubChem CID: 49779913
Max Phase: Preclinical
Molecular Formula: C28H29F2N5O4S
Molecular Weight: 569.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4ccc(OCCN5CCCC5)nc4)cc23)c1F
Standard InChI: InChI=1S/C28H29F2N5O4S/c1-2-13-40(37,38)34-23-7-6-22(29)25(26(23)30)27(36)21-17-33-28-20(21)14-19(16-32-28)18-5-8-24(31-15-18)39-12-11-35-9-3-4-10-35/h5-8,14-17,34H,2-4,9-13H2,1H3,(H,32,33)
Standard InChI Key: FPASKTFJWKPSOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
12.0647 -16.9194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0928 -17.7388 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.7884 -17.3048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2273 -17.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2254 -18.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9335 -18.5216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9317 -16.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6403 -17.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6451 -18.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4295 -18.3624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9095 -17.6936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4217 -17.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8302 -16.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6473 -16.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4218 -15.6156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0529 -17.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8693 -17.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2790 -16.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8663 -15.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0512 -15.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6399 -14.9115 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.6426 -17.7392 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.2773 -17.7411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5025 -18.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3197 -18.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7277 -19.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5226 -16.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5242 -16.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8174 -15.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1086 -16.0686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1110 -16.8900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8184 -17.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4004 -15.6608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6932 -16.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6941 -16.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9860 -17.2969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3179 -16.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6593 -17.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9159 -18.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7330 -18.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 14 1 0
20 21 1 0
16 22 1 0
17 23 1 0
23 2 1 0
2 24 1 0
24 25 1 0
25 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
4 27 1 0
30 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.63Molecular Weight (Monoisotopic): 569.1908AlogP: 4.76#Rotatable Bonds: 11Polar Surface Area: 117.28Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.06CX Basic pKa: 8.43CX LogP: 3.18CX LogD: 2.39Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.58
References 1. (2012) Compounds and methods for kinase modulation, and indications thereof,