The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8487093, 104 ID: ALA3959010
PubChem CID: 44184420
Max Phase: Preclinical
Molecular Formula: C16H25N5O7S
Molecular Weight: 431.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@H]1CCN(C2CCNCC2)C1=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O
Standard InChI: InChI=1S/C16H25N5O7S/c22-14(18-12-5-8-19(15(12)23)10-3-6-17-7-4-10)13-2-1-11-9-20(13)16(24)21(11)28-29(25,26)27/h10-13,17H,1-9H2,(H,18,22)(H,25,26,27)/t11-,12-,13+/m1/s1
Standard InChI Key: WSTRNZBLNKKHSG-UPJWGTAASA-N
Molfile:
RDKit 2D
29 32 0 0 1 0 0 0 0 0999 V2000
-1.5290 -4.1726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6608 -3.7738 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 -4.5549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4400 -4.9533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9361 -2.2985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2223 -1.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6055 1.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7867 1.6253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0965 3.2488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0640 4.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5458 4.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1139 5.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9692 6.6256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0806 8.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3750 8.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3734 10.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0736 11.1190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7754 10.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7769 8.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6935 5.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5803 6.2844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 1
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
11 13 1 0
13 6 1 0
13 14 2 0
10 15 1 6
15 16 2 0
15 17 1 0
18 17 1 1
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 22 1 0
21 28 1 0
28 18 1 0
28 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.47Molecular Weight (Monoisotopic): 431.1475AlogP: -1.54#Rotatable Bonds: 5Polar Surface Area: 148.59Molecular Species: ZWITTERIONHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.97CX Basic pKa: 10.02CX LogP: -3.89CX LogD: -3.90Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.44Np Likeness Score: -0.39
References 1. (2013) Œ=-lactamase inhibitors,