The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)-5-(3-methoxyprop-1-ynyl)phenoxy)acetic acid ID: ALA3959289
PubChem CID: 134155549
Max Phase: Preclinical
Molecular Formula: C25H30N2O7S
Molecular Weight: 502.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCC#Cc1cc(OCC(=O)O)cc(N2CCN(S(=O)(=O)c3ccc(OC(C)C)cc3)CC2)c1
Standard InChI: InChI=1S/C25H30N2O7S/c1-19(2)34-22-6-8-24(9-7-22)35(30,31)27-12-10-26(11-13-27)21-15-20(5-4-14-32-3)16-23(17-21)33-18-25(28)29/h6-9,15-17,19H,10-14,18H2,1-3H3,(H,28,29)
Standard InChI Key: ASVXPGATWJTQRF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
18.0071 -8.4361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4198 -9.1459 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.8282 -8.4336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1839 -10.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1827 -11.6081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8908 -12.0170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6004 -11.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5976 -10.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8890 -10.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3012 -10.3738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0103 -10.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7144 -10.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7155 -9.5565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0064 -9.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2962 -9.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8906 -12.8342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1828 -13.2427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1826 -14.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4748 -14.4683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8902 -14.4686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1310 -9.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1269 -10.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8338 -10.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5425 -10.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5399 -9.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8324 -9.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2507 -10.7803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9579 -10.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6662 -10.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9568 -9.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4761 -10.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7655 -9.9714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0572 -9.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3501 -9.9736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6417 -9.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
13 2 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
4 31 1 0
31 32 3 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.59Molecular Weight (Monoisotopic): 502.1774AlogP: 2.45#Rotatable Bonds: 9Polar Surface Area: 105.61Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.52CX Basic pKa: 0.92CX LogP: 3.05CX LogD: -0.32Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.52Np Likeness Score: -1.44
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,