The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8487093, 108 ID: ALA3959427
PubChem CID: 44184563
Max Phase: Preclinical
Molecular Formula: C13H21FN4O6S
Molecular Weight: 380.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@H]1CCCNC[C@H]1F)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O
Standard InChI: InChI=1S/C13H21FN4O6S/c14-9-6-15-5-1-2-10(9)16-12(19)11-4-3-8-7-17(11)13(20)18(8)24-25(21,22)23/h8-11,15H,1-7H2,(H,16,19)(H,21,22,23)/t8-,9-,10+,11+/m1/s1
Standard InChI Key: TVTNYRVZKCCMSJ-ZNSHCXBVSA-N
Molfile:
RDKit 2D
25 27 0 0 1 0 0 0 0 0999 V2000
-1.5290 -4.1726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6608 -3.7738 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 -4.5549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4400 -4.9533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9361 -2.2985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2223 -1.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6055 1.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7867 1.6253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0965 3.2488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0640 4.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5267 4.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7264 4.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7705 6.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6257 7.4012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1542 7.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4639 5.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2646 5.8200 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 1
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
11 13 1 0
13 6 1 0
13 14 2 0
10 15 1 6
15 16 2 0
15 17 1 0
18 17 1 6
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 18 1 0
24 25 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.40Molecular Weight (Monoisotopic): 380.1166AlogP: -0.80#Rotatable Bonds: 4Polar Surface Area: 128.28Molecular Species: ZWITTERIONHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.98CX Basic pKa: 8.82CX LogP: -2.40CX LogD: -2.41Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.54Np Likeness Score: -0.38
References 1. (2013) Œ=-lactamase inhibitors,