The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,6-dihydro-2-(1-[[4-n-butoxy]benzamido]-2-phenylethyl)-1,4-dithiin-1,1,4,4,-tetraoxide ID: ALA3961540
PubChem CID: 134155181
Max Phase: Preclinical
Molecular Formula: C23H27NO6S2
Molecular Weight: 477.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOc1ccccc1C(=O)NC(Cc1ccccc1)C1=CS(=O)(=O)CCS1(=O)=O
Standard InChI: InChI=1S/C23H27NO6S2/c1-2-3-13-30-21-12-8-7-11-19(21)23(25)24-20(16-18-9-5-4-6-10-18)22-17-31(26,27)14-15-32(22,28)29/h4-12,17,20H,2-3,13-16H2,1H3,(H,24,25)
Standard InChI Key: AWFOBYWKVZYQKK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
6.1258 -11.6752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7139 -10.9597 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.3015 -11.6726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2978 -8.5838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7139 -9.3036 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.1297 -8.5813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0023 -9.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0023 -10.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4328 -10.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4328 -9.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2869 -9.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3131 -8.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6178 -8.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8886 -8.4301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1913 -7.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2233 -7.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9525 -6.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6497 -7.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5337 -10.5282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8104 -10.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7846 -11.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0572 -12.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3555 -11.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3813 -10.8729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1088 -10.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2352 -10.9624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5595 -9.7049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4820 -12.1751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8293 -14.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1319 -14.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1577 -13.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4562 -12.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
7 5 1 0
8 2 1 0
2 9 1 0
9 10 1 0
10 5 1 0
7 11 1 0
11 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
12 13 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
19 26 2 0
19 27 1 0
29 30 1 0
30 31 1 0
31 32 1 0
28 32 1 0
21 28 1 0
11 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.60Molecular Weight (Monoisotopic): 477.1280AlogP: 2.89#Rotatable Bonds: 9Polar Surface Area: 106.61Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.95CX LogD: 1.95Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -0.82
References 1. (2002) 1,4-dithiin and 1,4-dithiepin-1,1,4,4, tetroxide derivatives useful as antagonists of the human galanin receptor,