5,6-dihydro-2-(1-[[4-n-butoxy]benzamido]-2-phenylethyl)-1,4-dithiin-1,1,4,4,-tetraoxide

ID: ALA3961540

PubChem CID: 134155181

Max Phase: Preclinical

Molecular Formula: C23H27NO6S2

Molecular Weight: 477.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOc1ccccc1C(=O)NC(Cc1ccccc1)C1=CS(=O)(=O)CCS1(=O)=O

Standard InChI:  InChI=1S/C23H27NO6S2/c1-2-3-13-30-21-12-8-7-11-19(21)23(25)24-20(16-18-9-5-4-6-10-18)22-17-31(26,27)14-15-32(22,28)29/h4-12,17,20H,2-3,13-16H2,1H3,(H,24,25)

Standard InChI Key:  AWFOBYWKVZYQKK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    6.1258  -11.6752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7139  -10.9597    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3015  -11.6726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2978   -8.5838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7139   -9.3036    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.1297   -8.5813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0023   -9.7239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0023  -10.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4328  -10.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4328   -9.7239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2869   -9.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3131   -8.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6178   -8.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8886   -8.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1913   -7.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2233   -7.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9525   -6.7812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6497   -7.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5337  -10.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8104  -10.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7846  -11.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0572  -12.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3555  -11.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3813  -10.8729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1088  -10.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2352  -10.9624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5595   -9.7049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4820  -12.1751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8293  -14.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1319  -14.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1577  -13.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4562  -12.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  7  5  1  0
  8  2  1  0
  2  9  1  0
  9 10  1  0
 10  5  1  0
  7 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 12 13  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 19 26  2  0
 19 27  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 28 32  1  0
 21 28  1  0
 11 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3961540

    ---

Associated Targets(Human)

GALR1 Tchem Galanin receptor 1 (253 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.60Molecular Weight (Monoisotopic): 477.1280AlogP: 2.89#Rotatable Bonds: 9
Polar Surface Area: 106.61Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.95CX LogD: 1.95
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -0.82

References

1.  (2002)  1,4-dithiin and 1,4-dithiepin-1,1,4,4, tetroxide derivatives useful as antagonists of the human galanin receptor, 

Source