The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl-1-(4-(N'-(tert-butoxycarbonyl)carbamimidoyl)benzyl)-8-(1-(pyrrolidine-1-carbonyl)cyclopentyl)-3,4-dihydrobenzo[4,5]imidazo[1,2-a]pyrazine-2(1H)-carboxylate ID: ALA3961893
Max Phase: Preclinical
Molecular Formula: C38H50N6O5
Molecular Weight: 670.86
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)/N=C(\N)c1ccc(CC2c3nc4cc(C5(C(=O)N6CCCC6)CCCC5)ccc4n3CCN2C(=O)OC(C)(C)C)cc1
Standard InChI: InChI=1S/C38H50N6O5/c1-36(2,3)48-34(46)41-31(39)26-13-11-25(12-14-26)23-30-32-40-28-24-27(38(17-7-8-18-38)33(45)42-19-9-10-20-42)15-16-29(28)43(32)21-22-44(30)35(47)49-37(4,5)6/h11-16,24,30H,7-10,17-23H2,1-6H3,(H2,39,41,46)
Standard InChI Key: QMUFQBIQMQJUED-UHFFFAOYSA-N
Molfile:
RDKit 2D
49 54 0 0 0 0 0 0 0 0999 V2000
6.3796 -10.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1760 -10.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5946 -10.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5595 -4.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3479 -5.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1434 -5.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8894 -6.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7034 -6.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5987 -5.6223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2267 -5.8907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9360 -5.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1219 -4.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2450 -6.9094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5560 -6.4557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7745 -5.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1948 -5.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3966 -5.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1781 -6.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7577 -6.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0407 -6.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3315 -6.7970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5298 -5.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3798 -6.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5556 -6.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3370 -7.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0261 -7.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6705 -7.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2559 -5.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8725 -4.9217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4729 -5.2100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8024 -5.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1380 -5.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3979 -4.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2230 -4.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9942 -7.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4709 -7.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6569 -7.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1336 -8.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4244 -9.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2385 -9.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7617 -8.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9012 -9.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1919 -10.6241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0952 -9.6753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5394 -10.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7893 -11.0711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7334 -10.1083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4264 -11.5006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6791 -6.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
7 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
9 12 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
15 16 2 0
9 15 1 0
7 13 2 0
20 21 2 0
20 22 1 0
10 20 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
23 27 1 0
28 29 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
30 34 1 0
28 30 1 0
23 28 1 0
18 23 1 0
35 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
36 41 2 0
42 43 1 0
42 44 2 0
45 46 2 0
47 2 1 0
45 47 1 0
44 45 1 0
39 42 1 0
8 35 1 0
22 5 1 0
2 48 1 0
5 49 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 670.86Molecular Weight (Monoisotopic): 670.3843AlogP: 6.65#Rotatable Bonds: 5Polar Surface Area: 132.35Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 4.73CX LogP: 5.79CX LogD: 5.79Aromatic Rings: 3Heavy Atoms: 49QED Weighted: 0.24Np Likeness Score: -0.75
References 1. Chen D, Shi J, Liu J, Zhang X, Deng X, Yang Y, Cui S, Zhu Q, Gong G, Xu Y.. (2017) Design, synthesis and antithrombotic evaluation of novel non-peptide thrombin inhibitors., 25 (2): [PMID:27884512 ] [10.1016/j.bmc.2016.11.012 ]