US9428478, TG6-161

ID: ALA3962276

PubChem CID: 71116385

Max Phase: Preclinical

Molecular Formula: C22H23N3O3

Molecular Weight: 377.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N2CCN(C(=O)c3cc4cc(C(C)=O)ccc4[nH]3)CC2)cc1

Standard InChI:  InChI=1S/C22H23N3O3/c1-15(26)16-3-8-20-17(13-16)14-21(23-20)22(27)25-11-9-24(10-12-25)18-4-6-19(28-2)7-5-18/h3-8,13-14,23H,9-12H2,1-2H3

Standard InChI Key:  KRGVYBFVCTWSKJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -3.9394  -13.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7395  -13.4959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9798  -12.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4798  -12.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2768  -10.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4666   -9.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9666   -9.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7232  -10.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2883   -8.3139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7883   -8.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5428   -7.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7974   -5.7210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2973   -5.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4572   -7.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497   -4.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7497   -4.4245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0432    3.5993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351    3.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  9  1  0
 12 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 25 17  1  0
 21 26  1  0
 26 27  2  0
 26 28  1  0
M  END

Associated Targets(Human)

CYBB Tchem Cytochrome b-245 heavy chain (193 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XDH Tclin Xanthine dehydrogenase (1038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.44Molecular Weight (Monoisotopic): 377.1739AlogP: 3.34#Rotatable Bonds: 4
Polar Surface Area: 65.64Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.60CX Basic pKa: 3.99CX LogP: 2.43CX LogD: 2.43
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.71Np Likeness Score: -1.26

References

1.  (2016)  Piperazine derivatives, compositions, and uses related thereto, 

Source

Source(1):