The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9409887, I-4 ID: ALA3962343
PubChem CID: 117828117
Max Phase: Preclinical
Molecular Formula: C23H25ClN6O2
Molecular Weight: 452.95
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(NC(C)C)cc3OC)ncc2Cl)c1
Standard InChI: InChI=1S/C23H25ClN6O2/c1-5-21(31)27-15-7-6-8-16(11-15)28-22-18(24)13-25-23(30-22)29-19-10-9-17(26-14(2)3)12-20(19)32-4/h5-14,26H,1H2,2-4H3,(H,27,31)(H2,25,28,29,30)
Standard InChI Key: IEZFFFOOLULQBR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3064 4.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 3.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 -5.2494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9485 -5.8368 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.9020 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1977 -2.9829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1903 -1.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4841 -0.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4738 0.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1696 1.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8758 0.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5693 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2759 0.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2862 -0.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0306 1.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0648 0.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8861 -0.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
7 9 1 0
5 10 2 0
10 11 1 0
11 12 2 0
12 3 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 30 2 0
25 31 2 0
31 21 1 0
19 32 2 0
32 14 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.95Molecular Weight (Monoisotopic): 452.1728AlogP: 5.57#Rotatable Bonds: 9Polar Surface Area: 100.20Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.94CX Basic pKa: 5.74CX LogP: 4.89CX LogD: 4.88Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -1.41
References 1. (2016) Mutant-selective EGFR inhibitors and uses thereof,