6-methyl-3-p-tolyl-2-(3,4,5-trimethoxybenzylthio)quinazolin-4(3H)-one

ID: ALA3962703

PubChem CID: 134152091

Max Phase: Preclinical

Molecular Formula: C26H26N2O4S

Molecular Weight: 462.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CSc2nc3ccc(C)cc3c(=O)n2-c2ccc(C)cc2)cc(OC)c1OC

Standard InChI:  InChI=1S/C26H26N2O4S/c1-16-6-9-19(10-7-16)28-25(29)20-12-17(2)8-11-21(20)27-26(28)33-15-18-13-22(30-3)24(32-5)23(14-18)31-4/h6-14H,15H2,1-5H3

Standard InChI Key:  FYKUFLDVBBXGQA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   84.4021  -23.7719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   84.4010  -24.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   85.1158  -25.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   85.1140  -23.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   85.8294  -23.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   85.8301  -24.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   86.5454  -25.0061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   87.2605  -24.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.2557  -23.7614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   86.5398  -23.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.9646  -23.3463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   88.6819  -23.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.3933  -23.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.3888  -22.5141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   88.6668  -22.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.9583  -22.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.9765  -25.0011    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   87.9797  -25.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   88.6958  -26.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   88.6956  -27.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.4109  -27.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.1247  -27.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.1188  -26.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.4030  -25.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   86.5354  -22.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   90.8413  -27.4636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   91.5536  -27.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.8302  -25.8078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   89.4137  -28.2952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   90.1296  -28.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.8241  -24.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   83.6875  -23.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.1002  -22.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 25  2  0
 22 26  1  0
 26 27  1  0
 23 28  1  0
 21 29  1  0
 29 30  1  0
 28 31  1  0
  1 32  1  0
 14 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3962703

    ---

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.57Molecular Weight (Monoisotopic): 462.1613AlogP: 5.32#Rotatable Bonds: 7
Polar Surface Area: 62.58Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.32CX LogP: 6.20CX LogD: 6.20
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: -1.23

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source