The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8487093, 264 ID: ALA3963057
PubChem CID: 58529988
Max Phase: Preclinical
Molecular Formula: C13H21N3O8S
Molecular Weight: 379.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(OCC1CNCCCO1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O
Standard InChI: InChI=1S/C13H21N3O8S/c17-12(23-8-10-6-14-4-1-5-22-10)11-3-2-9-7-15(11)13(18)16(9)24-25(19,20)21/h9-11,14H,1-8H2,(H,19,20,21)/t9-,10?,11+/m1/s1
Standard InChI Key: JOCNFPCECUDFRC-FBKFWFMHSA-N
Molfile:
RDKit 2D
25 27 0 0 1 0 0 0 0 0999 V2000
-1.5290 -4.1726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6608 -3.7738 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 -4.5549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4400 -4.9533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9361 -2.2985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2223 -1.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6055 1.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7867 1.6253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0965 3.2488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0640 4.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5550 5.8080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5978 6.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4128 8.3849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1337 9.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7236 8.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2444 7.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0569 5.9745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 1
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
11 13 1 0
13 6 1 0
13 14 2 0
10 15 1 6
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.39Molecular Weight (Monoisotopic): 379.1049AlogP: -1.09#Rotatable Bonds: 5Polar Surface Area: 134.71Molecular Species: ZWITTERIONHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: -2.06CX Basic pKa: 9.63CX LogP: -2.49CX LogD: -2.49Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.45Np Likeness Score: -0.15
References 1. (2013) Œ=-lactamase inhibitors,