2-(N-((3S,3aR,6R,6aS)-6-(benzyloxy)hexahydrofuro[3,2-b]furan-3-yl)-2-(4-methoxyphenyl)acetamido)-N-cyclohexyl-2-methylpropanamide

ID: ALA3963267

PubChem CID: 134151146

Max Phase: Preclinical

Molecular Formula: C32H42N2O6

Molecular Weight: 550.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CC(=O)N([C@H]2CO[C@H]3[C@@H]2OC[C@H]3OCc2ccccc2)C(C)(C)C(=O)NC2CCCCC2)cc1

Standard InChI:  InChI=1S/C32H42N2O6/c1-32(2,31(36)33-24-12-8-5-9-13-24)34(28(35)18-22-14-16-25(37-3)17-15-22)26-20-39-30-27(21-40-29(26)30)38-19-23-10-6-4-7-11-23/h4,6-7,10-11,14-17,24,26-27,29-30H,5,8-9,12-13,18-21H2,1-3H3,(H,33,36)/t26-,27+,29+,30+/m0/s1

Standard InChI Key:  YIKINYJURYSMCU-UGWFNHDDSA-N

Molfile:  

     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
   15.7289  -11.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5184  -12.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3140  -12.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8460  -12.0284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7794  -10.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3356  -11.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5748  -10.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6137  -11.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4063  -11.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8588  -11.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3433  -10.6276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6075  -12.5550    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.5703  -10.0952    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6998  -12.7207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1782  -13.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9171  -13.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4675  -14.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3676  -13.2262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0440  -14.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7383  -13.4682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4962  -14.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1386  -14.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7102  -14.8885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1070  -15.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9284  -15.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3516  -14.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9573  -14.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4873   -9.9348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6660   -9.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2568   -9.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6764   -8.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2678   -7.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4457   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0337   -8.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4405   -9.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2287  -14.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8049  -15.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1995  -16.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0222  -16.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4422  -15.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7796  -16.9191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1744  -17.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  8  1  0
  7  5  1  0
  5  6  1  0
  6  4  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  8 12  1  6
  7 13  1  6
  9 14  1  6
 14 15  1  0
 14  2  1  0
  2 16  1  0
 15 17  1  0
 15 18  2  0
 17 19  1  0
 16 20  1  0
 16 21  2  0
 20 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  5 28  1  1
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 19 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 19  1  0
 41 42  1  0
 38 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3963267

    ---

Associated Targets(Human)

KLK1 Tchem Kallikrein 1 (594 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KLK7 Tchem Kallikrein 7 (657 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.70Molecular Weight (Monoisotopic): 550.3043AlogP: 4.05#Rotatable Bonds: 10
Polar Surface Area: 86.33Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.27CX LogD: 4.27
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.48Np Likeness Score: -0.24

References

1. Barros TG, Santos JAN, de Souza BEG, Sodero ACR, de Souza AMT, da Silva DP, Rodrigues CR, Pinheiro S, Dias LRS, Abrahim-Vieira B, Puzer L, Muri EMF..  (2017)  Discovery of a new isomannide-based peptidomimetic synthetized by Ugi multicomponent reaction as human tissue kallikrein 1 inhibitor.,  27  (2): [PMID:27914800] [10.1016/j.bmcl.2016.11.051]

Source