The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9359371, 44 ID: ALA3963361
PubChem CID: 73214183
Max Phase: Preclinical
Molecular Formula: C25H33ClN6O2
Molecular Weight: 485.03
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNc2nc(N3CCC4(CC4)C3)ncc2C(=O)N[C@H]2CC[C@H](N)CC2)cc1Cl
Standard InChI: InChI=1S/C25H33ClN6O2/c1-34-21-7-2-16(12-20(21)26)13-28-22-19(23(33)30-18-5-3-17(27)4-6-18)14-29-24(31-22)32-11-10-25(15-32)8-9-25/h2,7,12,14,17-18H,3-6,8-11,13,15,27H2,1H3,(H,30,33)(H,28,29,31)/t17-,18-
Standard InChI Key: HFRJKYSYQXQKQU-IYARVYRRSA-N
Molfile:
RDKit 2D
34 38 0 0 1 0 0 0 0 0999 V2000
-3.4394 11.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2766 10.5771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8700 9.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4155 8.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0061 7.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0511 6.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6444 4.8016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6915 3.7263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2848 2.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8304 1.9147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4232 0.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4660 -0.6044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9204 -0.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3298 1.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7858 1.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1154 2.7236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.8298 0.4915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.2858 0.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3309 -0.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7853 0.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1948 1.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.3583 1.8830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.1498 2.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.6954 2.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4527 -1.4334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9615 -1.4334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4293 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9079 -0.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4251 1.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2071 0.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5056 6.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9150 8.0563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0785 8.3499 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
15 16 2 0
15 17 1 0
18 17 1 6
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 1
21 23 1 0
23 24 1 0
24 18 1 0
11 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 28 1 0
28 31 1 0
31 25 1 0
6 32 1 0
32 33 2 0
33 3 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.03Molecular Weight (Monoisotopic): 484.2354AlogP: 3.74#Rotatable Bonds: 7Polar Surface Area: 105.40Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.15CX LogP: 3.79CX LogD: 1.21Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -1.17
References 1. (2016) Bicyclic substituted pyrimidine compounds,