US8497376, 9

ID: ALA3963729

PubChem CID: 57666466

Max Phase: Preclinical

Molecular Formula: C28H32N4O3

Molecular Weight: 472.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CC=C(c2cc([C@@]3(O)C[C@]4(C)C=C[C@](C)(C3)O4)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1

Standard InChI:  InChI=1S/C28H32N4O3/c1-25(2)9-7-18(8-10-25)21-13-19(28(34)16-26(3)11-12-27(4,17-28)35-26)5-6-22(21)32-24(33)23-30-15-20(14-29)31-23/h5-7,11-13,15,34H,8-10,16-17H2,1-4H3,(H,30,31)(H,32,33)/t26-,27+,28+

Standard InChI Key:  XNSXNDURWCBTFS-KUMHGWDASA-N

Molfile:  

     RDKit          2D

 35 39  0  0  1  0  0  0  0  0999 V2000
    4.6931   -8.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4939   -8.5932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8823   -9.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2279   -7.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4619   -5.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9620   -6.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2281   -7.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9940   -8.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1936   -4.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9255   -3.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1575   -2.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3424   -2.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0742   -3.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3063   -4.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0412   -6.0540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5419   -6.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1545   -5.0408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2769   -7.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7557   -7.5397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0471   -9.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7378   -9.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5605  -11.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4185  -12.4223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6371   -8.7239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8975   -0.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0972   -0.8313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9488    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8393    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2943   -1.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0947    1.4779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6393   -0.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6421    0.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6568   -0.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8063   -1.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  2  1  0
  6  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  3  0
 21 24  1  0
 24 18  1  0
 11 25  1  0
 25 26  1  6
 25 27  1  0
 27 28  1  0
 28 29  1  1
 28 30  1  0
 30 31  1  0
 31 32  1  6
 31 33  1  0
 33 25  1  0
 31 34  1  0
 34 35  2  0
 35 28  1  0
M  END

Associated Targets(non-human)

Csf1r Macrophage colony-stimulating factor 1 receptor (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.2474AlogP: 5.21#Rotatable Bonds: 4
Polar Surface Area: 111.03Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.80CX Basic pKa: 0.62CX LogP: 3.69CX LogD: 2.85
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: 0.40

References

1.  (2013)  4-Cyano-1H-imidazole-2-carboxylic acid [2-cyclohex-1-enyl-4-(2,6-dioxo-piperidin-4-yl)-phenyl]-amide; tyrosine kinase inhibitor; autoimmune diseases, antiinflammatory, anticarcinogenic agent, 

Source

Source(1):