The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8497376, 9 ID: ALA3963729
PubChem CID: 57666466
Max Phase: Preclinical
Molecular Formula: C28H32N4O3
Molecular Weight: 472.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC=C(c2cc([C@@]3(O)C[C@]4(C)C=C[C@](C)(C3)O4)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1
Standard InChI: InChI=1S/C28H32N4O3/c1-25(2)9-7-18(8-10-25)21-13-19(28(34)16-26(3)11-12-27(4,17-28)35-26)5-6-22(21)32-24(33)23-30-15-20(14-29)31-23/h5-7,11-13,15,34H,8-10,16-17H2,1-4H3,(H,30,31)(H,32,33)/t26-,27+,28+
Standard InChI Key: XNSXNDURWCBTFS-KUMHGWDASA-N
Molfile:
RDKit 2D
35 39 0 0 1 0 0 0 0 0999 V2000
4.6931 -8.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4939 -8.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8823 -9.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2279 -7.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4619 -5.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9620 -6.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2281 -7.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9940 -8.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1936 -4.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9255 -3.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1575 -2.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3424 -2.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0742 -3.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3063 -4.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0412 -6.0540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5419 -6.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1545 -5.0408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2769 -7.3813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7557 -7.5397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0471 -9.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7378 -9.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5605 -11.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4185 -12.4223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6371 -8.7239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0972 -0.8313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2943 -1.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6393 -0.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 2 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 3 0
21 24 1 0
24 18 1 0
11 25 1 0
25 26 1 6
25 27 1 0
27 28 1 0
28 29 1 1
28 30 1 0
30 31 1 0
31 32 1 6
31 33 1 0
33 25 1 0
31 34 1 0
34 35 2 0
35 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.2474AlogP: 5.21#Rotatable Bonds: 4Polar Surface Area: 111.03Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.80CX Basic pKa: 0.62CX LogP: 3.69CX LogD: 2.85Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: 0.40
References 1. (2013) 4-Cyano-1H-imidazole-2-carboxylic acid [2-cyclohex-1-enyl-4-(2,6-dioxo-piperidin-4-yl)-phenyl]-amide; tyrosine kinase inhibitor; autoimmune diseases, antiinflammatory, anticarcinogenic agent,