The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394303, 55 ID: ALA3964397
PubChem CID: 118424708
Max Phase: Preclinical
Molecular Formula: C27H20FN3O3
Molecular Weight: 453.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(Cc2ccc(Oc3ccccc3)cc2)c2nc(-c3ccc(F)cc3)cc(C(=O)O)c12
Standard InChI: InChI=1S/C27H20FN3O3/c1-17-25-23(27(32)33)15-24(19-9-11-20(28)12-10-19)29-26(25)31(30-17)16-18-7-13-22(14-8-18)34-21-5-3-2-4-6-21/h2-15H,16H2,1H3,(H,32,33)
Standard InChI Key: JRHCWMGLWITZHO-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8794 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8823 -2.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3506 -2.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3506 -3.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8824 -4.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8807 -5.9175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4102 -7.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4064 -8.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9332 -9.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4640 -10.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4678 -9.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9409 -7.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4142 -5.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4142 -3.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6387 -0.8963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 -2.6978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0067 7.2009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 1 0
17 18 2 0
18 6 1 0
4 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
23 27 2 0
27 2 1 0
27 19 1 0
21 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
31 33 1 0
33 34 2 0
34 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.47Molecular Weight (Monoisotopic): 453.1489AlogP: 6.08#Rotatable Bonds: 6Polar Surface Area: 77.24Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.52CX Basic pKa: 1.86CX LogP: 5.61CX LogD: 2.39Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.48
References 1. (2016) Small molecule inhibitors of MCL-1 and uses thereof,