MePhe-MeGly-Gly-Gly-Gly-MePhe-NH2

ID: ALA396440

PubChem CID: 23731179

Max Phase: Preclinical

Molecular Formula: C29H39N7O6

Molecular Weight: 581.67

Molecule Type: Protein

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN[C@@H](Cc1ccccc1)C(=O)N(C)CC(=O)NCC(=O)NCC(=O)NCC(=O)N(C)[C@@H](Cc1ccccc1)C(N)=O

Standard InChI:  InChI=1S/C29H39N7O6/c1-31-22(14-20-10-6-4-7-11-20)29(42)35(2)19-26(39)33-17-24(37)32-16-25(38)34-18-27(40)36(3)23(28(30)41)15-21-12-8-5-9-13-21/h4-13,22-23,31H,14-19H2,1-3H3,(H2,30,41)(H,32,37)(H,33,39)(H,34,38)/t22-,23-/m0/s1

Standard InChI Key:  JEBGAQKLXAWQEQ-GOTSBHOMSA-N

Molfile:  

     RDKit          2D

 42 43  0  0  1  0  0  0  0  0999 V2000
   -4.3875  -15.9458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6730  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9586  -15.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2441  -15.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9586  -16.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1020  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5296  -15.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8151  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6730  -14.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3875  -14.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3847  -13.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0984  -13.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8138  -13.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8112  -14.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0969  -14.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1007  -15.9458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8151  -14.7083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6138  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3283  -15.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3283  -16.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0427  -15.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7572  -15.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4717  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1862  -15.9458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4717  -14.7083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9006  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6151  -15.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6151  -16.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3296  -15.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0440  -15.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3296  -14.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0440  -16.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7585  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4730  -15.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4681  -16.7719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1817  -17.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8971  -16.7718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8945  -15.9425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1803  -15.5338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3296  -17.1833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7585  -17.1833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2441  -14.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 19 21  1  0
 10 11  2  0
 21 22  1  0
  1  6  1  0
 22 23  1  0
 11 12  1  0
 23 24  1  0
  1  2  1  0
 23 25  2  0
 12 13  2  0
 24 26  1  0
  4  7  1  0
 26 27  1  0
 13 14  1  0
 27 28  2  0
  3  4  1  0
 27 29  1  0
 14 15  2  0
 29 30  1  0
 15 10  1  0
 29 31  1  0
  7  8  1  0
 30 32  1  0
  8 16  1  0
 30 33  1  1
 33 34  1  0
  8 17  2  0
 34 35  2  0
  2  9  1  1
 35 36  1  0
 16 18  1  0
 36 37  2  0
  3  5  2  0
 37 38  1  0
 18 19  1  0
 38 39  2  0
 39 34  1  0
  9 10  1  0
 32 40  2  0
 19 20  2  0
 32 41  1  0
  2  3  1  0
  4 42  1  0
M  END

Alternative Forms

Associated Targets(Human)

Caco-2 (12174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Intestine (155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 581.67Molecular Weight (Monoisotopic): 581.2962AlogP: -1.82#Rotatable Bonds: 16
Polar Surface Area: 183.04Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.06CX Basic pKa: 8.37CX LogP: -2.15CX LogD: -3.17
Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -0.52

References

1. Hess S, Ovadia O, Shalev DE, Senderovich H, Qadri B, Yehezkel T, Salitra Y, Sheynis T, Jelinek R, Gilon C, Hoffman A..  (2007)  Effect of structural and conformation modifications, including backbone cyclization, of hydrophilic hexapeptides on their intestinal permeability and enzymatic stability.,  50  (24): [PMID:17983214] [10.1021/jm070836d]

Source