The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
MePhe-MeGly-Gly-Gly-Gly-MePhe-NH2 ID: ALA396440
PubChem CID: 23731179
Max Phase: Preclinical
Molecular Formula: C29H39N7O6
Molecular Weight: 581.67
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H](Cc1ccccc1)C(=O)N(C)CC(=O)NCC(=O)NCC(=O)NCC(=O)N(C)[C@@H](Cc1ccccc1)C(N)=O
Standard InChI: InChI=1S/C29H39N7O6/c1-31-22(14-20-10-6-4-7-11-20)29(42)35(2)19-26(39)33-17-24(37)32-16-25(38)34-18-27(40)36(3)23(28(30)41)15-21-12-8-5-9-13-21/h4-13,22-23,31H,14-19H2,1-3H3,(H2,30,41)(H,32,37)(H,33,39)(H,34,38)/t22-,23-/m0/s1
Standard InChI Key: JEBGAQKLXAWQEQ-GOTSBHOMSA-N
Molfile:
RDKit 2D
42 43 0 0 1 0 0 0 0 0999 V2000
-4.3875 -15.9458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6730 -15.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9586 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2441 -15.5333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9586 -16.7708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1020 -15.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5296 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8151 -15.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6730 -14.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3875 -14.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3847 -13.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0984 -13.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8138 -13.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8112 -14.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0969 -14.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1007 -15.9458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8151 -14.7083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6138 -15.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3283 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3283 -16.7708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0427 -15.5333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7572 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4717 -15.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1862 -15.9458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4717 -14.7083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9006 -15.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6151 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6151 -16.7708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3296 -15.5333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0440 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3296 -14.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0440 -16.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7585 -15.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4730 -15.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4681 -16.7719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1817 -17.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8971 -16.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8945 -15.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1803 -15.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3296 -17.1833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7585 -17.1833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2441 -14.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 21 1 0
10 11 2 0
21 22 1 0
1 6 1 0
22 23 1 0
11 12 1 0
23 24 1 0
1 2 1 0
23 25 2 0
12 13 2 0
24 26 1 0
4 7 1 0
26 27 1 0
13 14 1 0
27 28 2 0
3 4 1 0
27 29 1 0
14 15 2 0
29 30 1 0
15 10 1 0
29 31 1 0
7 8 1 0
30 32 1 0
8 16 1 0
30 33 1 1
33 34 1 0
8 17 2 0
34 35 2 0
2 9 1 1
35 36 1 0
16 18 1 0
36 37 2 0
3 5 2 0
37 38 1 0
18 19 1 0
38 39 2 0
39 34 1 0
9 10 1 0
32 40 2 0
19 20 2 0
32 41 1 0
2 3 1 0
4 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.67Molecular Weight (Monoisotopic): 581.2962AlogP: -1.82#Rotatable Bonds: 16Polar Surface Area: 183.04Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.06CX Basic pKa: 8.37CX LogP: -2.15CX LogD: -3.17Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -0.52
References 1. Hess S, Ovadia O, Shalev DE, Senderovich H, Qadri B, Yehezkel T, Salitra Y, Sheynis T, Jelinek R, Gilon C, Hoffman A.. (2007) Effect of structural and conformation modifications, including backbone cyclization, of hydrophilic hexapeptides on their intestinal permeability and enzymatic stability., 50 (24): [PMID:17983214 ] [10.1021/jm070836d ]