The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394289, 5 ID: ALA3965172
PubChem CID: 24875272
Max Phase: Preclinical
Molecular Formula: C24H29N5O2
Molecular Weight: 419.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC=C(c2cc(C3(N)CCOCC3)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1
Standard InChI: InChI=1S/C24H29N5O2/c1-23(2)7-5-16(6-8-23)19-13-17(24(26)9-11-31-12-10-24)3-4-20(19)29-22(30)21-27-15-18(14-25)28-21/h3-5,13,15H,6-12,26H2,1-2H3,(H,27,28)(H,29,30)
Standard InChI Key: GOIKZFAIJSSESM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.3238 -0.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2709 -1.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9014 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3042 3.7556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3088 5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3501 5.8529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0118 6.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1236 7.4927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5903 7.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3424 6.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8327 6.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0264 6.2315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3406 5.3928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4956 0.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5345 1.3445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 0.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1955 -1.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4941 -2.2145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7935 -1.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7943 0.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 2 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 3 0
21 24 1 0
24 18 1 0
11 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.53Molecular Weight (Monoisotopic): 419.2321AlogP: 4.09#Rotatable Bonds: 4Polar Surface Area: 116.82Molecular Species: ZWITTERIONHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.80CX Basic pKa: 9.65CX LogP: 0.02CX LogD: -0.48Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.69Np Likeness Score: -0.16
References 1. (2016) Inhibitors of c-fms kinase,