US9006282, Example 2, Compound 6::US9102656, Example 2, Compound 6

ID: ALA3965745

PubChem CID: 134151194

Max Phase: Preclinical

Molecular Formula: C32H38FN3O5S

Molecular Weight: 595.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCOC1C[C@@H](OCc2ccccc2)C[C@H](/C=C/c2c(-c3ccc(F)cc3)nc(N(C)S(C)(=O)=O)nc2C(C)C)O1

Standard InChI:  InChI=1S/C32H38FN3O5S/c1-6-18-39-29-20-27(40-21-23-10-8-7-9-11-23)19-26(41-29)16-17-28-30(22(2)3)34-32(36(4)42(5,37)38)35-31(28)24-12-14-25(33)15-13-24/h6-17,22,26-27,29H,1,18-21H2,2-5H3/b17-16+/t26-,27-,29?/m0/s1

Standard InChI Key:  OMFUKTXBDFLJRM-OBJOSVLBSA-N

Molfile:  

     RDKit          2D

 44 47  0  0  0  0  0  0  0  0999 V2000
    8.4906    5.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0037   -3.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1091   -1.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3628   -0.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2757   -4.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8995    3.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2697   -7.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7592   -7.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3713   -6.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3503   -5.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9624   -4.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5170    3.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9230    3.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4330    5.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8390    5.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5031    0.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7519    1.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4100    3.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2755   -0.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7628    0.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0430   -3.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9198   -1.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4519   -4.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2619    2.9679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0940    5.9632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8421    1.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7358   -0.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0909    0.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3294    1.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1748   -0.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3459    1.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7688   -0.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0101    7.4608    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5138   -1.5251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6849    0.7941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1078   -1.3797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6941   -2.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6894   -2.7934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8189    2.1074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1447   -1.9780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8691    2.2727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1917   -2.8773    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.9438    2.3807    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9908   -1.4209    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  2 22  1  0
  3 22  1  0
  4 36  1  0
  5 42  1  0
  6 18  1  0
  7  8  2  0
  7  9  1  0
  8 10  1  0
  9 11  2  0
 10 23  2  0
 11 23  1  0
 12 14  1  0
 12 24  2  0
 13 15  2  0
 13 24  1  0
 14 25  2  0
 15 25  1  0
 16 17  2  0
 16 26  1  0
 17 28  1  0
 18 39  1  0
 19 26  1  0
 19 27  1  0
 20 27  1  0
 20 29  1  0
 21 23  1  0
 21 40  1  0
 22 30  1  0
 24 31  1  0
 25 33  1  0
 26 43  1  1
 26 41  1  0
 27 44  1  6
 27 40  1  0
 28 30  2  0
 28 31  1  0
 29 39  1  0
 29 41  1  0
 30 34  1  0
 31 35  2  0
 32 34  2  0
 32 35  1  0
 32 36  1  0
 36 42  1  0
 37 42  2  0
 38 42  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3965745

    ---

Associated Targets(non-human)

Hmgcr HMG-CoA reductase (1653 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 595.74Molecular Weight (Monoisotopic): 595.2516AlogP: 6.11#Rotatable Bonds: 12
Polar Surface Area: 90.85Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.33CX LogD: 6.33
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -0.29

References

1.  (2015)  Rosuvastatin and atorvastatin derivatives, 

Source

Source(1):