The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394289, 90 ID: ALA3966302
PubChem CID: 24874816
Max Phase: Preclinical
Molecular Formula: C26H30F3N5O2
Molecular Weight: 501.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC=C(c2cc(C3(O)CCN(CC(F)(F)F)CC3)ccc2NC(=O)c2nc(C#N)c[nH]2)CC1
Standard InChI: InChI=1S/C26H30F3N5O2/c1-24(2)7-5-17(6-8-24)20-13-18(25(36)9-11-34(12-10-25)16-26(27,28)29)3-4-21(20)33-23(35)22-31-15-19(14-30)32-22/h3-5,13,15,36H,6-12,16H2,1-2H3,(H,31,32)(H,33,35)
Standard InChI Key: DTWARAJRJYFWLG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
2.3238 -0.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2709 -1.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9014 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3042 3.7556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3088 5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3501 5.8529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0118 6.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1236 7.4927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5903 7.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3424 6.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3406 5.3928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1975 9.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6837 10.2737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4956 0.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5345 1.3445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 0.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1955 -1.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4941 -2.2145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4965 -3.7154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7970 -4.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7989 -5.6645 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.8354 -3.8632 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.8370 -5.0631 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.7935 -1.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7943 0.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 2 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
20 23 1 0
23 24 3 0
11 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
29 35 1 0
35 36 1 0
36 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.55Molecular Weight (Monoisotopic): 501.2352AlogP: 4.97#Rotatable Bonds: 5Polar Surface Area: 105.04Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.44CX Basic pKa: 2.68CX LogP: 4.14CX LogD: 3.87Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.54Np Likeness Score: -0.56
References 1. (2016) Inhibitors of c-fms kinase,