US9475795, 92

ID: ALA3966384

PubChem CID: 72547673

Max Phase: Preclinical

Molecular Formula: C18H20ClFN4O2S

Molecular Weight: 410.90

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(C(C#N)c2ccc(Cl)cc2F)CC1

Standard InChI:  InChI=1S/C18H20ClFN4O2S/c1-11-18(12(2)23-22-11)27(25,26)24-7-5-13(6-8-24)16(10-21)15-4-3-14(19)9-17(15)20/h3-4,9,13,16H,5-8H2,1-2H3,(H,22,23)

Standard InChI Key:  WNAZGHKRUVTSKH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    3.1417    1.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0377    0.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5052    1.0408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2543   -0.2587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2499   -1.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4917   -2.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5984   -2.7004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6030    2.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6051    4.1986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5291   -1.3672    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2049    2.6909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  2  0
  8 10  2  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
 18 19  3  0
 17 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 20  1  0
 26 27  1  0
M  END

Associated Targets(Human)

PROKR1 Tchem Prokineticin receptor 1 (175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.90Molecular Weight (Monoisotopic): 410.0980AlogP: 3.53#Rotatable Bonds: 4
Polar Surface Area: 89.85Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.98CX Basic pKa: 2.62CX LogP: 2.40CX LogD: 2.40
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.83Np Likeness Score: -2.03

References

1.  (2016)  Sulfonyl piperidine derivatives and their use for treating prokineticin mediated diseases, 

Source

Source(1):