The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)-2-(propylcarbamoyl)phenoxy)acetic acid ID: ALA3966654
PubChem CID: 134150792
Max Phase: Preclinical
Molecular Formula: C25H33N3O7S
Molecular Weight: 519.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)c1ccc(N2CCN(S(=O)(=O)c3ccc(OC(C)C)cc3)CC2)cc1OCC(=O)O
Standard InChI: InChI=1S/C25H33N3O7S/c1-4-11-26-25(31)22-10-5-19(16-23(22)34-17-24(29)30)27-12-14-28(15-13-27)36(32,33)21-8-6-20(7-9-21)35-18(2)3/h5-10,16,18H,4,11-15,17H2,1-3H3,(H,26,31)(H,29,30)
Standard InChI Key: WWWWXIYDYUUKGQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
32.9064 -15.6793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3191 -16.3892 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.7275 -15.6769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0832 -18.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0820 -18.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7901 -19.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4997 -18.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4969 -18.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7883 -17.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2005 -17.6170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9096 -18.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6137 -17.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6148 -16.7998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9057 -16.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1955 -16.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7899 -20.0775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0821 -20.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0819 -21.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3740 -21.7116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7895 -21.7119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0303 -16.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0262 -17.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7331 -18.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4418 -17.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4392 -16.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7317 -16.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1500 -18.0236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8572 -17.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5655 -18.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8561 -16.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3782 -19.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3795 -20.0764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6699 -18.8517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9628 -19.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2544 -18.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5474 -19.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
13 2 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
5 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.62Molecular Weight (Monoisotopic): 519.2039AlogP: 2.59#Rotatable Bonds: 11Polar Surface Area: 125.48Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.65CX Basic pKa: 0.26CX LogP: 2.65CX LogD: -0.67Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.46Np Likeness Score: -1.79
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,