The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)pyridin-2-yloxy)acetic acid ID: ALA3966776
PubChem CID: 134149910
Max Phase: Preclinical
Molecular Formula: C20H25N3O6S
Molecular Weight: 435.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Oc1ccc(S(=O)(=O)N2CCN(c3cccc(OCC(=O)O)n3)CC2)cc1
Standard InChI: InChI=1S/C20H25N3O6S/c1-15(2)29-16-6-8-17(9-7-16)30(26,27)23-12-10-22(11-13-23)18-4-3-5-19(21-18)28-14-20(24)25/h3-9,15H,10-14H2,1-2H3,(H,24,25)
Standard InChI Key: NSKNOTNWUBNVGU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
7.9532 -0.7842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9573 -1.6055 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6671 -1.1933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8980 -0.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5004 -1.6437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9198 -2.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7369 -2.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1386 -1.6160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7191 -0.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6798 -1.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2558 -0.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4353 -0.9696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0380 -1.6847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4629 -2.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2820 -2.3748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3773 -2.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9758 -3.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3926 -3.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2147 -3.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6183 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1951 -2.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6372 -4.4319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4585 -4.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8769 -5.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8572 -3.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0689 -3.1118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2478 -3.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8496 -3.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0285 -3.8654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2767 -4.5520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
5 10 1 0
8 2 1 0
2 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
14 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.50Molecular Weight (Monoisotopic): 435.1464AlogP: 1.84#Rotatable Bonds: 8Polar Surface Area: 109.27Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.01CX Basic pKa: 4.75CX LogP: 1.40CX LogD: -0.68Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -1.90
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,