The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(Naphthalen-1-yl)-4-(pyridin-4-yl)-1H-1,2,3-triazol-1-yl)-N-(5-phenylpyridin-2-yl)acetamide ID: ALA3968025
PubChem CID: 134150710
Max Phase: Preclinical
Molecular Formula: C30H22N6O
Molecular Weight: 482.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cn1nnc(-c2ccncc2)c1-c1cccc2ccccc12)Nc1ccc(-c2ccccc2)cn1
Standard InChI: InChI=1S/C30H22N6O/c37-28(33-27-14-13-24(19-32-27)21-7-2-1-3-8-21)20-36-30(29(34-35-36)23-15-17-31-18-16-23)26-12-6-10-22-9-4-5-11-25(22)26/h1-19H,20H2,(H,32,33,37)
Standard InChI Key: KVIGWEJPUMMRKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
14.0666 -2.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3647 -3.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0553 -2.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7790 -3.3806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4809 -2.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1982 -3.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8952 -2.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8847 -2.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1756 -1.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4696 -2.1456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5907 -1.7069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3031 -2.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0050 -1.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9937 -0.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2813 -0.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5794 -0.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5880 -3.1455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3347 -2.3678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5175 -2.3664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2656 -3.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9239 -3.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5382 -4.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3158 -4.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4880 -3.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8824 -2.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1048 -3.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9327 -3.8992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9204 -4.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2098 -4.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2068 -5.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9138 -6.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6246 -4.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6226 -5.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3258 -6.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0314 -5.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0294 -4.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3256 -4.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
8 11 1 0
4 5 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
17 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
20 24 1 0
2 17 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 33 1 0
32 28 1 0
21 28 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.55Molecular Weight (Monoisotopic): 482.1855AlogP: 5.86#Rotatable Bonds: 6Polar Surface Area: 85.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.76CX Basic pKa: 3.79CX LogP: 5.33CX LogD: 5.33Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -1.44
References 1. You L, Zhang C, Yarravarapu N, Morlock L, Wang X, Zhang L, Williams NS, Lum L, Chen C.. (2016) Development of a triazole class of highly potent Porcn inhibitors., 26 (24): [PMID:27876319 ] [10.1016/j.bmcl.2016.11.012 ]