The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8497376, 19 ID: ALA3968152
PubChem CID: 57666482
Max Phase: Preclinical
Molecular Formula: C25H29N5O4
Molecular Weight: 463.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC(c3ccc(NC(=O)c4ncc(C#N)[nH]4)c(C4=CCCCC4)n3)C[C@](C)(O1)[C@H](O)[C@@H]2O
Standard InChI: InChI=1S/C25H29N5O4/c1-24-10-15(11-25(2,34-24)21(32)20(24)31)17-8-9-18(19(29-17)14-6-4-3-5-7-14)30-23(33)22-27-13-16(12-26)28-22/h6,8-9,13,15,20-21,31-32H,3-5,7,10-11H2,1-2H3,(H,27,28)(H,30,33)/t15?,20-,21+,24+,25-
Standard InChI Key: FFHAUJKTAWRKHY-QNELOFPJSA-N
Molfile:
RDKit 2D
34 38 0 0 1 0 0 0 0 0999 V2000
-0.2943 -1.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6393 -0.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2223 -1.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6902 -2.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 -2.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9949 -2.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1594 -4.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9505 -5.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1182 -6.5714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4933 -7.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4592 -6.4607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6610 -8.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9615 -9.3857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6573 -10.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1664 -11.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4240 -12.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8294 -13.3628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5491 -9.6520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5770 -4.4770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4125 -2.9861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3675 -5.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5296 -6.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6807 -7.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0532 -7.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2154 -5.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0051 -4.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 6
6 8 1 0
8 2 1 0
6 9 1 0
9 10 1 6
9 11 1 0
11 2 1 0
11 12 1 6
4 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 3 0
23 26 1 0
26 20 1 0
16 27 1 0
27 28 2 0
28 13 1 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.54Molecular Weight (Monoisotopic): 463.2220AlogP: 3.03#Rotatable Bonds: 4Polar Surface Area: 144.15Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.81CX Basic pKa: 4.19CX LogP: 1.80CX LogD: 1.08Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: 0.13
References 1. (2013) 4-Cyano-1H-imidazole-2-carboxylic acid [2-cyclohex-1-enyl-4-(2,6-dioxo-piperidin-4-yl)-phenyl]-amide; tyrosine kinase inhibitor; autoimmune diseases, antiinflammatory, anticarcinogenic agent,