US9187470, 115

ID: ALA3968420

PubChem CID: 118194941

Max Phase: Preclinical

Molecular Formula: C29H35N5O3

Molecular Weight: 501.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc3c(c2)CN(C(=O)C2CCOCC2)C3)cc1

Standard InChI:  InChI=1S/C29H35N5O3/c1-19-5-9-24(10-6-19)34-26(16-25(32-34)29(2,3)4)31-28(36)30-23-8-7-21-17-33(18-22(21)15-23)27(35)20-11-13-37-14-12-20/h5-10,15-16,20H,11-14,17-18H2,1-4H3,(H2,30,31,36)

Standard InChI Key:  VTYMXEWQPNQWBZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   10.6080   -4.6727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4415   -4.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4073   -3.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9493   -4.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5279   -5.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5597   -6.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0177   -6.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1017   -6.1218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6332   -7.5468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1332   -7.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6747   -6.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5548   -3.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1047   -0.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7065    1.0350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8532   -1.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3533   -1.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0987   -2.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3442   -3.9074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8442   -3.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0987   -2.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2484   -8.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7320   -9.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0554   -8.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5392   -9.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 24 25  2  0
 25 17  1  0
 22 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 28  1  0
 10 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Associated Targets(Human)

MAPK13 Tchem MAP kinase p38 delta (2605 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.63Molecular Weight (Monoisotopic): 501.2740AlogP: 5.39#Rotatable Bonds: 4
Polar Surface Area: 88.49Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.36CX Basic pKa: 1.90CX LogP: 5.08CX LogD: 5.08
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.50Np Likeness Score: -1.76

References

1.  (2015)  Anti-mucus drugs and uses therefor, 

Source

Source(1):