The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9187470, 115 ID: ALA3968420
PubChem CID: 118194941
Max Phase: Preclinical
Molecular Formula: C29H35N5O3
Molecular Weight: 501.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc3c(c2)CN(C(=O)C2CCOCC2)C3)cc1
Standard InChI: InChI=1S/C29H35N5O3/c1-19-5-9-24(10-6-19)34-26(16-25(32-34)29(2,3)4)31-28(36)30-23-8-7-21-17-33(18-22(21)15-23)27(35)20-11-13-37-14-12-20/h5-10,15-16,20H,11-14,17-18H2,1-4H3,(H2,30,31,36)
Standard InChI Key: VTYMXEWQPNQWBZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
10.6080 -4.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4415 -4.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4073 -3.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9493 -4.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5279 -5.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5597 -6.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0177 -6.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1017 -6.1218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6332 -7.5468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1332 -7.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6747 -6.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1047 -0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7065 1.0350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8532 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3533 -1.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0987 -2.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3442 -3.9074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8442 -3.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0987 -2.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2484 -8.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7320 -9.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0554 -8.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5392 -9.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
24 25 2 0
25 17 1 0
22 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
10 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.63Molecular Weight (Monoisotopic): 501.2740AlogP: 5.39#Rotatable Bonds: 4Polar Surface Area: 88.49Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.36CX Basic pKa: 1.90CX LogP: 5.08CX LogD: 5.08Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.50Np Likeness Score: -1.76
References 1. (2015) Anti-mucus drugs and uses therefor,