The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9428478, TG6-239 ID: ALA3969051
PubChem CID: 71116153
Max Phase: Preclinical
Molecular Formula: C23H23N3O4
Molecular Weight: 405.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N2CCN(C(=O)c3cnc4cc(C(C)=O)ccc4c3O)CC2)cc1
Standard InChI: InChI=1S/C23H23N3O4/c1-15(27)16-3-8-19-21(13-16)24-14-20(22(19)28)23(29)26-11-9-25(10-12-26)17-4-6-18(30-2)7-5-17/h3-8,13-14H,9-12H2,1-2H3,(H,24,28)
Standard InChI Key: BWUUTOZEQYHASO-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
11.6663 4.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6740 3.7912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3796 3.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3872 1.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0920 0.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7891 1.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7816 3.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0768 3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 0.7636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4972 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2368 0.8962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2005 2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 9 1 0
12 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 20 1 0
25 26 2 0
26 17 1 0
26 27 1 0
22 28 1 0
28 29 2 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.45Molecular Weight (Monoisotopic): 405.1689AlogP: 3.11#Rotatable Bonds: 4Polar Surface Area: 82.97Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.76CX Basic pKa: 3.99CX LogP: 2.91CX LogD: 2.90Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -1.15
References 1. (2016) Piperazine derivatives, compositions, and uses related thereto,