The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(benzyloxy)-5-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)phenoxy)acetic acid ID: ALA3969111
PubChem CID: 134153775
Max Phase: Preclinical
Molecular Formula: C28H32N2O7S
Molecular Weight: 540.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Oc1ccc(S(=O)(=O)N2CCN(c3ccc(OCc4ccccc4)c(OCC(=O)O)c3)CC2)cc1
Standard InChI: InChI=1S/C28H32N2O7S/c1-21(2)37-24-9-11-25(12-10-24)38(33,34)30-16-14-29(15-17-30)23-8-13-26(27(18-23)36-20-28(31)32)35-19-22-6-4-3-5-7-22/h3-13,18,21H,14-17,19-20H2,1-2H3,(H,31,32)
Standard InChI Key: BERKVDZPYQRXTQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
34.9040 -15.9105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3167 -16.6203 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.7251 -15.9080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0807 -18.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0796 -19.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7876 -19.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4973 -19.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4945 -18.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7859 -17.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1981 -17.8482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9072 -18.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6113 -17.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6124 -17.0310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9033 -16.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1931 -17.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7874 -20.3086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0796 -20.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0794 -21.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3716 -21.9427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7870 -21.9430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0278 -17.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0238 -17.8472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7307 -18.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4394 -17.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4368 -17.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7293 -16.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1476 -18.2548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8548 -17.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5630 -18.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8537 -17.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3716 -19.4905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6642 -19.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9562 -19.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2495 -19.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5420 -19.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5409 -20.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2532 -20.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9579 -20.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
13 2 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
5 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.64Molecular Weight (Monoisotopic): 540.1930AlogP: 4.03#Rotatable Bonds: 11Polar Surface Area: 105.61Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.73CX Basic pKa: 2.09CX LogP: 4.12CX LogD: 0.96Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.39Np Likeness Score: -1.41
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,