US9428501, 58

ID: ALA3969654

PubChem CID: 118378631

Max Phase: Preclinical

Molecular Formula: C32H36F3N7O2

Molecular Weight: 607.68

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1cnc(CN2CCC(n3cc4cc(C(=O)N5CCN(Cc6ccc(C(F)(F)F)cc6)CC5)ccc4n3)CC2)cn1

Standard InChI:  InChI=1S/C32H36F3N7O2/c1-2-44-30-19-36-27(18-37-30)22-39-11-9-28(10-12-39)42-21-25-17-24(5-8-29(25)38-42)31(43)41-15-13-40(14-16-41)20-23-3-6-26(7-4-23)32(33,34)35/h3-8,17-19,21,28H,2,9-16,20,22H2,1H3

Standard InChI Key:  QSBPMVRDJQONFS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 44 49  0  0  0  0  0  0  0  0999 V2000
   -1.0819  -14.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000  -13.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0960  -13.4245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9490  -12.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4443  -12.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2942  -11.0717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6488   -9.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4967   -8.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8490   -7.1253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6946   -5.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0445   -4.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5536   -4.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7031   -5.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3532   -7.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351    3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3092    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9073    5.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2112    5.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5072    5.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8115    5.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1053    5.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0949    3.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7907    2.9679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4969    3.7269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3895    2.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4332    3.5416    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3808    1.7495    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4242    2.3418    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9021    3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6005    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1534   -9.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3035  -10.8356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 17  1  0
 22 23  2  0
 23 15  1  0
 19 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
 37 38  1  0
 37 39  1  0
 37 40  1  0
 29 41  1  0
 41 42  1  0
 42 26  1  0
  7 43  1  0
 43 44  2  0
 44  4  1  0
M  END

Associated Targets(Human)

PRKAA2 Tchem AMP-activated protein kinase, alpha-2 subunit (1328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CA Tclin PI3-kinase p110-alpha subunit (12269 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 607.68Molecular Weight (Monoisotopic): 607.2883AlogP: 5.04#Rotatable Bonds: 8
Polar Surface Area: 79.62Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.45CX LogP: 3.71CX LogD: 3.36
Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.28Np Likeness Score: -1.50

References

1.  (2016)  Bicyclic nitrogen-containing aromatic heterocyclic amide compound, 

Source

Source(1):