The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[1-(2-{1E)-3-[9-(4-Methoxyphenyl)-9H-fluoren-9-yl]propenyloxy}ethyl)-1H-imidazol-2-yl]propanoic acid ID: ALA3969687
PubChem CID: 134154058
Max Phase: Preclinical
Molecular Formula: C31H30N2O4
Molecular Weight: 494.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2(/C=C/COCCn3ccnc3CCC(=O)O)c3ccccc3-c3ccccc32)cc1
Standard InChI: InChI=1S/C31H30N2O4/c1-36-24-13-11-23(12-14-24)31(27-9-4-2-7-25(27)26-8-3-5-10-28(26)31)17-6-21-37-22-20-33-19-18-32-29(33)15-16-30(34)35/h2-14,17-19H,15-16,20-22H2,1H3,(H,34,35)/b17-6+
Standard InChI Key: HRUZDAUMBPGGNG-UBKPWBPPSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
17.3740 -11.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1704 -11.1205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2444 -10.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4903 -9.9851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9563 -10.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9459 -9.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9336 -9.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6351 -8.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6229 -7.8340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3489 -9.0490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0060 -15.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5974 -16.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3508 -15.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5585 -15.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0122 -16.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2635 -16.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0552 -17.0652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6690 -15.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4137 -16.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9579 -17.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7574 -16.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0099 -16.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4640 -15.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7092 -14.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4199 -15.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1226 -14.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1152 -13.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3991 -13.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6993 -13.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8183 -13.5482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5305 -13.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2936 -14.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2933 -13.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5854 -13.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5851 -12.7534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8773 -12.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8770 -11.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
12 19 1 0
18 11 1 0
11 13 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
11 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.59Molecular Weight (Monoisotopic): 494.2206AlogP: 5.50#Rotatable Bonds: 11Polar Surface Area: 73.58Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.06CX Basic pKa: 6.10CX LogP: 3.81CX LogD: 2.53Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -0.32
References 1. Kerscher-Hack S, Renukappa-Gutke T, Höfner G, Wanner KT.. (2016) Synthesis and biological evaluation of a series of N-alkylated imidazole alkanoic acids as mGAT3 selective GABA uptake inhibitors., 124 [PMID:27654218 ] [10.1016/j.ejmech.2016.09.012 ]