The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)-2-(methylcarbamoyl)phenoxy)acetic acid ID: ALA3969800
PubChem CID: 134154584
Max Phase: Preclinical
Molecular Formula: C23H29N3O7S
Molecular Weight: 491.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1ccc(N2CCN(S(=O)(=O)c3ccc(OC(C)C)cc3)CC2)cc1OCC(=O)O
Standard InChI: InChI=1S/C23H29N3O7S/c1-16(2)33-18-5-7-19(8-6-18)34(30,31)26-12-10-25(11-13-26)17-4-9-20(23(29)24-3)21(14-17)32-15-22(27)28/h4-9,14,16H,10-13,15H2,1-3H3,(H,24,29)(H,27,28)
Standard InChI Key: FHZDWXSQNKRBSI-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
33.3398 -7.0163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7525 -7.7262 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.1609 -7.0138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5165 -9.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5154 -10.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2234 -10.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9331 -10.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9303 -9.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2216 -8.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6339 -8.9540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3430 -9.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0471 -8.9543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0482 -8.1368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3391 -7.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6289 -8.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2232 -11.4145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5154 -11.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5152 -12.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8074 -13.0485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2228 -13.0488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4636 -8.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4596 -8.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1665 -9.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8752 -8.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8725 -8.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1651 -7.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5834 -9.3606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2906 -8.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9988 -9.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2895 -8.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8116 -10.5961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8128 -11.4133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1032 -10.1887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3961 -10.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
13 2 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
5 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.57Molecular Weight (Monoisotopic): 491.1726AlogP: 1.81#Rotatable Bonds: 9Polar Surface Area: 125.48Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.66CX Basic pKa: 0.26CX LogP: 1.78CX LogD: -1.54Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -1.74
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,