(S)-N-(4-(1-(2-(dimethylamino)-7-methylquinazolin-4-ylamino)ethyl)phenyl)-4-fluorobenzamide

ID: ALA3971423

PubChem CID: 68941419

Max Phase: Preclinical

Molecular Formula: C26H26FN5O

Molecular Weight: 443.53

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(N[C@@H](C)c3ccc(NC(=O)c4ccc(F)cc4)cc3)nc(N(C)C)nc2c1

Standard InChI:  InChI=1S/C26H26FN5O/c1-16-5-14-22-23(15-16)30-26(32(3)4)31-24(22)28-17(2)18-8-12-21(13-9-18)29-25(33)19-6-10-20(27)11-7-19/h5-15,17H,1-4H3,(H,29,33)(H,28,30,31)/t17-/m0/s1

Standard InChI Key:  FDQIPUBUNUJHCQ-KRWDZBQOSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    6.5854   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8804   -5.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8804   -5.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1713   -6.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4622   -5.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4622   -5.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1713   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5854   -3.8878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2945   -5.1136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7531   -6.3394    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.9994   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9994   -3.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7085   -3.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4176   -3.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4176   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7085   -5.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1267   -3.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1267   -2.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8317   -3.8878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8317   -6.3394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1267   -5.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1267   -5.1136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8317   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5407   -5.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2457   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9548   -5.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9548   -5.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2457   -6.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5407   -5.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6639   -6.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4176   -6.3394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4176   -7.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7085   -5.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
  5 10  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 17 18  1  6
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 20 29  2  0
 24 29  1  0
 27 30  1  0
 31 32  1  0
 31 33  1  0
 21 31  1  0
 19 23  1  0
 17 19  1  0
 14 17  1  0
  9 11  1  0
M  END

Associated Targets(Human)

CTNNB1 Tchem TCF4/beta-catenin (616 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.53Molecular Weight (Monoisotopic): 443.2121AlogP: 5.57#Rotatable Bonds: 6
Polar Surface Area: 70.15Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.99CX LogP: 6.17CX LogD: 6.03
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.72

References

1.  (2009)  Amino-substituted quinazoline derivatives as inhibitors of Beta-catenin/TCF-4 pathway and cancer treatment agents, 

Source